About 5-bromo-4-methyl-2,3-dihydro-1,4-benzoxazine
5-bromo-4-methyl-2,3-dihydro-1,4-benzoxazine (PubChem CID 83823671) has the molecular formula C9H10BrNO
and a molecular weight of 228.09 g/mol. Its IUPAC name is 5-bromo-4-methyl-2,3-dihydro-1,4-benzoxazine.
Molecular Properties
| Compound Name | 5-bromo-4-methyl-2,3-dihydro-1,4-benzoxazine |
| PubChem CID | 83823671 |
| Molecular Formula | C9H10BrNO |
| Molecular Weight | 228.09 g/mol |
| Exact Mass | 226.99 |
| IUPAC Name | 5-bromo-4-methyl-2,3-dihydro-1,4-benzoxazine |
| SMILES | CN1CCOc2cccc(Br)c21 |
| InChI | InChI=1S/C9H10BrNO/c1-11-5-6-12-8-4-2-3-7(10)9(8)11/h2-4H,5-6H2,1H3 |
| InChIKey | WBHINGLCTUADFG-UHFFFAOYSA-N |
| XLogP | 2.28 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 228.09 |
| LogP ≤ 5 | 2.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 5-bromo-4-methyl-2,3-dihydro-1,4-benzoxazine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-bromo-4-methyl-2,3-dihydro-1,4-benzoxazine?
The IUPAC name of 5-bromo-4-methyl-2,3-dihydro-1,4-benzoxazine (CID 83823671) is 5-bromo-4-methyl-2,3-dihydro-1,4-benzoxazine.
What is the SMILES notation for 5-bromo-4-methyl-2,3-dihydro-1,4-benzoxazine?
The canonical SMILES for 5-bromo-4-methyl-2,3-dihydro-1,4-benzoxazine is CN1CCOc2cccc(Br)c21.
What is the InChIKey of 5-bromo-4-methyl-2,3-dihydro-1,4-benzoxazine?
The InChIKey is WBHINGLCTUADFG-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H10BrNO/c1-11-5-6-12-8-4-2-3-7(10)9(8)11/h2-4H,5-6H2,1H3.
What are the key properties of 5-bromo-4-methyl-2,3-dihydro-1,4-benzoxazine?
5-bromo-4-methyl-2,3-dihydro-1,4-benzoxazine has a molecular weight of 228.09 g/mol, XLogP of 2.28, 0 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 5-bromo-4-methyl-2,3-dihydro-1,4-benzoxazine is sourced from PubChem (CID 83823671), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).