C12H18N2OS — CID 83824641
N'-(2-methoxyphenyl)-N'-(thietan-3-yl)ethane-1,2-diamine (PubChem CID 83824641) has the molecular formula C12H18N2OS and a molecular weight of 238.36 g/mol. Its IUPAC name is N'-(2-methoxyphenyl)-N'-(thietan-3-yl)ethane-1,2-diamine.
| Compound Name | N'-(2-methoxyphenyl)-N'-(thietan-3-yl)ethane-1,2-diamine |
|---|---|
| PubChem CID | 83824641 |
| Molecular Formula | C12H18N2OS |
| Molecular Weight | 238.36 g/mol |
| Exact Mass | 238.11 |
| IUPAC Name | N'-(2-methoxyphenyl)-N'-(thietan-3-yl)ethane-1,2-diamine |
| SMILES | COc1ccccc1N(CCN)C1CSC1 |
| InChI | InChI=1S/C12H18N2OS/c1-15-12-5-3-2-4-11(12)14(7-6-13)10-8-16-9-10/h2-5,10H,6-9,13H2,1H3 |
| InChIKey | NPEYMBPBAGLRJN-UHFFFAOYSA-N |
| XLogP | 1.58 |
| TPSA | 38.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 238.36 |
| LogP ≤ 5 | 1.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |