C10H19F3N2O — CID 83824795
5,5,5-trifluoro-2-methyl-4-piperazin-1-ylpentan-2-ol (PubChem CID 83824795) has the molecular formula C10H19F3N2O and a molecular weight of 240.27 g/mol. Its IUPAC name is 5,5,5-trifluoro-2-methyl-4-piperazin-1-ylpentan-2-ol.
| Compound Name | 5,5,5-trifluoro-2-methyl-4-piperazin-1-ylpentan-2-ol |
|---|---|
| PubChem CID | 83824795 |
| Molecular Formula | C10H19F3N2O |
| Molecular Weight | 240.27 g/mol |
| Exact Mass | 240.14 |
| IUPAC Name | 5,5,5-trifluoro-2-methyl-4-piperazin-1-ylpentan-2-ol |
| SMILES | CC(C)(O)CC(N1CCNCC1)C(F)(F)F |
| InChI | InChI=1S/C10H19F3N2O/c1-9(2,16)7-8(10(11,12)13)15-5-3-14-4-6-15/h8,14,16H,3-7H2,1-2H3 |
| InChIKey | GPHVVRWFNKKZKG-UHFFFAOYSA-N |
| XLogP | 0.98 |
| TPSA | 35.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 240.27 |
| LogP ≤ 5 | 0.98 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |