2-bromo-[1,2,4]triazolo[1,5-a]pyridine-6-carboxylic acid

C7H4BrN3O2 — CID 83824963

IUPAC2-bromo-[1,2,4]triazolo[1,5-a]pyridine-6-carboxylic acid
SMILESO=C(O)c1ccc2nc(Br)nn2c1
InChIInChI=1S/C7H4BrN3O2/c8-7-9-5-2-1-4(6(12)13)3-11(5)10-7/h1-3H,(H,12,13)
InChIKeyVIVLLDIWMJDPKW-UHFFFAOYSA-N
MW242.03 g/mol
LogP1.19
Rot. Bonds1

About 2-bromo-[1,2,4]triazolo[1,5-a]pyridine-6-carboxylic acid

2-bromo-[1,2,4]triazolo[1,5-a]pyridine-6-carboxylic acid (PubChem CID 83824963) has the molecular formula C7H4BrN3O2 and a molecular weight of 242.03 g/mol. Its IUPAC name is 2-bromo-[1,2,4]triazolo[1,5-a]pyridine-6-carboxylic acid.

Molecular Properties

Compound Name2-bromo-[1,2,4]triazolo[1,5-a]pyridine-6-carboxylic acid
PubChem CID83824963
Molecular FormulaC7H4BrN3O2
Molecular Weight242.03 g/mol
Exact Mass240.95
IUPAC Name2-bromo-[1,2,4]triazolo[1,5-a]pyridine-6-carboxylic acid
SMILESO=C(O)c1ccc2nc(Br)nn2c1
InChIInChI=1S/C7H4BrN3O2/c8-7-9-5-2-1-4(6(12)13)3-11(5)10-7/h1-3H,(H,12,13)
InChIKeyVIVLLDIWMJDPKW-UHFFFAOYSA-N
XLogP1.19
TPSA67.49 Ų
H-Bond Donors1
H-Bond Acceptors4
Rotatable Bonds1
Heavy Atoms13
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500242.03
LogP ≤ 51.19
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 104

Analyze 2-bromo-[1,2,4]triazolo[1,5-a]pyridine-6-carboxylic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 2-bromo-[1,2,4]triazolo[1,5-a]pyridine-6-carboxylic acid?
The IUPAC name of 2-bromo-[1,2,4]triazolo[1,5-a]pyridine-6-carboxylic acid (CID 83824963) is 2-bromo-[1,2,4]triazolo[1,5-a]pyridine-6-carboxylic acid.
What is the SMILES notation for 2-bromo-[1,2,4]triazolo[1,5-a]pyridine-6-carboxylic acid?
The canonical SMILES for 2-bromo-[1,2,4]triazolo[1,5-a]pyridine-6-carboxylic acid is O=C(O)c1ccc2nc(Br)nn2c1.
What is the InChIKey of 2-bromo-[1,2,4]triazolo[1,5-a]pyridine-6-carboxylic acid?
The InChIKey is VIVLLDIWMJDPKW-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H4BrN3O2/c8-7-9-5-2-1-4(6(12)13)3-11(5)10-7/h1-3H,(H,12,13).
What are the key properties of 2-bromo-[1,2,4]triazolo[1,5-a]pyridine-6-carboxylic acid?
2-bromo-[1,2,4]triazolo[1,5-a]pyridine-6-carboxylic acid has a molecular weight of 242.03 g/mol, XLogP of 1.19, 1 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-bromo-[1,2,4]triazolo[1,5-a]pyridine-6-carboxylic acid is sourced from PubChem (CID 83824963), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).