About 2-bromo-[1,2,4]triazolo[1,5-a]pyridine-7-carboxylic acid
2-bromo-[1,2,4]triazolo[1,5-a]pyridine-7-carboxylic acid (PubChem CID 83824965) has the molecular formula C7H4BrN3O2
and a molecular weight of 242.03 g/mol. Its IUPAC name is 2-bromo-[1,2,4]triazolo[1,5-a]pyridine-7-carboxylic acid.
Analyze 2-bromo-[1,2,4]triazolo[1,5-a]pyridine-7-carboxylic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-bromo-[1,2,4]triazolo[1,5-a]pyridine-7-carboxylic acid?
The IUPAC name of 2-bromo-[1,2,4]triazolo[1,5-a]pyridine-7-carboxylic acid (CID 83824965) is 2-bromo-[1,2,4]triazolo[1,5-a]pyridine-7-carboxylic acid.
What is the SMILES notation for 2-bromo-[1,2,4]triazolo[1,5-a]pyridine-7-carboxylic acid?
The canonical SMILES for 2-bromo-[1,2,4]triazolo[1,5-a]pyridine-7-carboxylic acid is O=C(O)c1ccn2nc(Br)nc2c1.
What is the InChIKey of 2-bromo-[1,2,4]triazolo[1,5-a]pyridine-7-carboxylic acid?
The InChIKey is SCOMEELYLURYAL-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H4BrN3O2/c8-7-9-5-3-4(6(12)13)1-2-11(5)10-7/h1-3H,(H,12,13).
What are the key properties of 2-bromo-[1,2,4]triazolo[1,5-a]pyridine-7-carboxylic acid?
2-bromo-[1,2,4]triazolo[1,5-a]pyridine-7-carboxylic acid has a molecular weight of 242.03 g/mol, XLogP of 1.19, 1 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-bromo-[1,2,4]triazolo[1,5-a]pyridine-7-carboxylic acid is sourced from PubChem (CID 83824965), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).