C9H8Cl2N4 — CID 83825049
[1-(2,5-dichlorophenyl)-1,2,4-triazol-3-yl]methanamine (PubChem CID 83825049) has the molecular formula C9H8Cl2N4 and a molecular weight of 243.10 g/mol. Its IUPAC name is [1-(2,5-dichlorophenyl)-1,2,4-triazol-3-yl]methanamine.
| Compound Name | [1-(2,5-dichlorophenyl)-1,2,4-triazol-3-yl]methanamine |
|---|---|
| PubChem CID | 83825049 |
| Molecular Formula | C9H8Cl2N4 |
| Molecular Weight | 243.10 g/mol |
| Exact Mass | 242.01 |
| IUPAC Name | [1-(2,5-dichlorophenyl)-1,2,4-triazol-3-yl]methanamine |
| SMILES | NCc1ncn(-c2cc(Cl)ccc2Cl)n1 |
| InChI | InChI=1S/C9H8Cl2N4/c10-6-1-2-7(11)8(3-6)15-5-13-9(4-12)14-15/h1-3,5H,4,12H2 |
| InChIKey | RWCKPBPLUISPTP-UHFFFAOYSA-N |
| XLogP | 2.03 |
| TPSA | 56.73 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 243.10 |
| LogP ≤ 5 | 2.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |