About 2-(1,2,4-triazin-3-ylamino)acetic acid
2-(1,2,4-triazin-3-ylamino)acetic acid (PubChem CID 83826415) has the molecular formula C5H6N4O2
and a molecular weight of 154.13 g/mol. Its IUPAC name is 2-(1,2,4-triazin-3-ylamino)acetic acid.
Molecular Properties
| Compound Name | 2-(1,2,4-triazin-3-ylamino)acetic acid |
| PubChem CID | 83826415 |
| Molecular Formula | C5H6N4O2 |
| Molecular Weight | 154.13 g/mol |
| Exact Mass | 154.05 |
| IUPAC Name | 2-(1,2,4-triazin-3-ylamino)acetic acid |
| SMILES | O=C(O)CNc1nccnn1 |
| InChI | InChI=1S/C5H6N4O2/c10-4(11)3-7-5-6-1-2-8-9-5/h1-2H,3H2,(H,10,11)(H,6,7,9) |
| InChIKey | MFWIJOJNTNCRON-UHFFFAOYSA-N |
| XLogP | -0.63 |
| TPSA | 88.00 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 154.13 |
| LogP ≤ 5 | -0.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 2-(1,2,4-triazin-3-ylamino)acetic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(1,2,4-triazin-3-ylamino)acetic acid?
The IUPAC name of 2-(1,2,4-triazin-3-ylamino)acetic acid (CID 83826415) is 2-(1,2,4-triazin-3-ylamino)acetic acid.
What is the SMILES notation for 2-(1,2,4-triazin-3-ylamino)acetic acid?
The canonical SMILES for 2-(1,2,4-triazin-3-ylamino)acetic acid is O=C(O)CNc1nccnn1.
What is the InChIKey of 2-(1,2,4-triazin-3-ylamino)acetic acid?
The InChIKey is MFWIJOJNTNCRON-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H6N4O2/c10-4(11)3-7-5-6-1-2-8-9-5/h1-2H,3H2,(H,10,11)(H,6,7,9).
What are the key properties of 2-(1,2,4-triazin-3-ylamino)acetic acid?
2-(1,2,4-triazin-3-ylamino)acetic acid has a molecular weight of 154.13 g/mol, XLogP of -0.63, 3 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(1,2,4-triazin-3-ylamino)acetic acid is sourced from PubChem (CID 83826415), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).