C9H11N3 — CID 83826625
(7-methylpyrazolo[1,5-a]pyridin-2-yl)methanamine (PubChem CID 83826625) has the molecular formula C9H11N3 and a molecular weight of 161.21 g/mol. Its IUPAC name is (7-methylpyrazolo[1,5-a]pyridin-2-yl)methanamine.
| Compound Name | (7-methylpyrazolo[1,5-a]pyridin-2-yl)methanamine |
|---|---|
| PubChem CID | 83826625 |
| Molecular Formula | C9H11N3 |
| Molecular Weight | 161.21 g/mol |
| Exact Mass | 161.10 |
| IUPAC Name | (7-methylpyrazolo[1,5-a]pyridin-2-yl)methanamine |
| SMILES | Cc1cccc2cc(CN)nn12 |
| InChI | InChI=1S/C9H11N3/c1-7-3-2-4-9-5-8(6-10)11-12(7)9/h2-5H,6,10H2,1H3 |
| InChIKey | WSLICKWPOXFMBR-UHFFFAOYSA-N |
| XLogP | 1.10 |
| TPSA | 43.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 161.21 |
| LogP ≤ 5 | 1.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |