C9H11NO2 — CID 83826793
2,3,4,5-tetrahydro-1,4-benzoxazepin-6-ol (PubChem CID 83826793) has the molecular formula C9H11NO2 and a molecular weight of 165.19 g/mol. Its IUPAC name is 2,3,4,5-tetrahydro-1,4-benzoxazepin-6-ol.
| Compound Name | 2,3,4,5-tetrahydro-1,4-benzoxazepin-6-ol |
|---|---|
| PubChem CID | 83826793 |
| Molecular Formula | C9H11NO2 |
| Molecular Weight | 165.19 g/mol |
| Exact Mass | 165.08 |
| IUPAC Name | 2,3,4,5-tetrahydro-1,4-benzoxazepin-6-ol |
| SMILES | Oc1cccc2c1CNCCO2 |
| InChI | InChI=1S/C9H11NO2/c11-8-2-1-3-9-7(8)6-10-4-5-12-9/h1-3,10-11H,4-6H2 |
| InChIKey | SVZOUBOXWBVTIF-UHFFFAOYSA-N |
| XLogP | 0.87 |
| TPSA | 41.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 165.19 |
| LogP ≤ 5 | 0.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'} |
|---|