About 6-chloro-3,4-dihydro-1H-pyrano[3,4-c]pyridine
6-chloro-3,4-dihydro-1H-pyrano[3,4-c]pyridine (PubChem CID 83827162) has the molecular formula C8H8ClNO
and a molecular weight of 169.61 g/mol. Its IUPAC name is 6-chloro-3,4-dihydro-1H-pyrano[3,4-c]pyridine.
Molecular Properties
| Compound Name | 6-chloro-3,4-dihydro-1H-pyrano[3,4-c]pyridine |
| PubChem CID | 83827162 |
| Molecular Formula | C8H8ClNO |
| Molecular Weight | 169.61 g/mol |
| Exact Mass | 169.03 |
| IUPAC Name | 6-chloro-3,4-dihydro-1H-pyrano[3,4-c]pyridine |
| SMILES | Clc1cc2c(cn1)COCC2 |
| InChI | InChI=1S/C8H8ClNO/c9-8-3-6-1-2-11-5-7(6)4-10-8/h3-4H,1-2,5H2 |
| InChIKey | QOIBJOXGHPEWGW-UHFFFAOYSA-N |
| XLogP | 1.81 |
| TPSA | 22.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 169.61 |
| LogP ≤ 5 | 1.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|
Analyze 6-chloro-3,4-dihydro-1H-pyrano[3,4-c]pyridine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-chloro-3,4-dihydro-1H-pyrano[3,4-c]pyridine?
The IUPAC name of 6-chloro-3,4-dihydro-1H-pyrano[3,4-c]pyridine (CID 83827162) is 6-chloro-3,4-dihydro-1H-pyrano[3,4-c]pyridine.
What is the SMILES notation for 6-chloro-3,4-dihydro-1H-pyrano[3,4-c]pyridine?
The canonical SMILES for 6-chloro-3,4-dihydro-1H-pyrano[3,4-c]pyridine is Clc1cc2c(cn1)COCC2.
What is the InChIKey of 6-chloro-3,4-dihydro-1H-pyrano[3,4-c]pyridine?
The InChIKey is QOIBJOXGHPEWGW-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H8ClNO/c9-8-3-6-1-2-11-5-7(6)4-10-8/h3-4H,1-2,5H2.
What are the key properties of 6-chloro-3,4-dihydro-1H-pyrano[3,4-c]pyridine?
6-chloro-3,4-dihydro-1H-pyrano[3,4-c]pyridine has a molecular weight of 169.61 g/mol, XLogP of 1.81, 0 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 6-chloro-3,4-dihydro-1H-pyrano[3,4-c]pyridine is sourced from PubChem (CID 83827162), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).