About N-methyl-2-pyrazolo[1,5-a]pyridin-2-ylethanamine
N-methyl-2-pyrazolo[1,5-a]pyridin-2-ylethanamine (PubChem CID 83827462) has the molecular formula C10H13N3
and a molecular weight of 175.24 g/mol. Its IUPAC name is N-methyl-2-pyrazolo[1,5-a]pyridin-2-ylethanamine.
Molecular Properties
| Compound Name | N-methyl-2-pyrazolo[1,5-a]pyridin-2-ylethanamine |
| PubChem CID | 83827462 |
| Molecular Formula | C10H13N3 |
| Molecular Weight | 175.24 g/mol |
| Exact Mass | 175.11 |
| IUPAC Name | N-methyl-2-pyrazolo[1,5-a]pyridin-2-ylethanamine |
| SMILES | CNCCc1cc2ccccn2n1 |
| InChI | InChI=1S/C10H13N3/c1-11-6-5-9-8-10-4-2-3-7-13(10)12-9/h2-4,7-8,11H,5-6H2,1H3 |
| InChIKey | IZACWQPSQFRBIQ-UHFFFAOYSA-N |
| XLogP | 1.10 |
| TPSA | 29.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 175.24 |
| LogP ≤ 5 | 1.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze N-methyl-2-pyrazolo[1,5-a]pyridin-2-ylethanamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-methyl-2-pyrazolo[1,5-a]pyridin-2-ylethanamine?
The IUPAC name of N-methyl-2-pyrazolo[1,5-a]pyridin-2-ylethanamine (CID 83827462) is N-methyl-2-pyrazolo[1,5-a]pyridin-2-ylethanamine.
What is the SMILES notation for N-methyl-2-pyrazolo[1,5-a]pyridin-2-ylethanamine?
The canonical SMILES for N-methyl-2-pyrazolo[1,5-a]pyridin-2-ylethanamine is CNCCc1cc2ccccn2n1.
What is the InChIKey of N-methyl-2-pyrazolo[1,5-a]pyridin-2-ylethanamine?
The InChIKey is IZACWQPSQFRBIQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H13N3/c1-11-6-5-9-8-10-4-2-3-7-13(10)12-9/h2-4,7-8,11H,5-6H2,1H3.
What are the key properties of N-methyl-2-pyrazolo[1,5-a]pyridin-2-ylethanamine?
N-methyl-2-pyrazolo[1,5-a]pyridin-2-ylethanamine has a molecular weight of 175.24 g/mol, XLogP of 1.10, 3 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N-methyl-2-pyrazolo[1,5-a]pyridin-2-ylethanamine is sourced from PubChem (CID 83827462), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).