C9H16N4 — CID 83828266
N'-(2-propan-2-ylpyrimidin-4-yl)ethane-1,2-diamine (PubChem CID 83828266) has the molecular formula C9H16N4 and a molecular weight of 180.25 g/mol. Its IUPAC name is N'-(2-propan-2-ylpyrimidin-4-yl)ethane-1,2-diamine.
| Compound Name | N'-(2-propan-2-ylpyrimidin-4-yl)ethane-1,2-diamine |
|---|---|
| PubChem CID | 83828266 |
| Molecular Formula | C9H16N4 |
| Molecular Weight | 180.25 g/mol |
| Exact Mass | 180.14 |
| IUPAC Name | N'-(2-propan-2-ylpyrimidin-4-yl)ethane-1,2-diamine |
| SMILES | CC(C)c1nccc(NCCN)n1 |
| InChI | InChI=1S/C9H16N4/c1-7(2)9-12-5-3-8(13-9)11-6-4-10/h3,5,7H,4,6,10H2,1-2H3,(H,11,12,13) |
| InChIKey | VUKQSSYWXKCLMJ-UHFFFAOYSA-N |
| XLogP | 0.97 |
| TPSA | 63.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 180.25 |
| LogP ≤ 5 | 0.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |