About 2-N-(6-ethylpyridazin-3-yl)propane-1,2-diamine
2-N-(6-ethylpyridazin-3-yl)propane-1,2-diamine (PubChem CID 83828270) has the molecular formula C9H16N4
and a molecular weight of 180.25 g/mol. Its IUPAC name is 2-N-(6-ethylpyridazin-3-yl)propane-1,2-diamine.
Molecular Properties
| Compound Name | 2-N-(6-ethylpyridazin-3-yl)propane-1,2-diamine |
| PubChem CID | 83828270 |
| Molecular Formula | C9H16N4 |
| Molecular Weight | 180.25 g/mol |
| Exact Mass | 180.14 |
| IUPAC Name | 2-N-(6-ethylpyridazin-3-yl)propane-1,2-diamine |
| SMILES | CCc1ccc(NC(C)CN)nn1 |
| InChI | InChI=1S/C9H16N4/c1-3-8-4-5-9(13-12-8)11-7(2)6-10/h4-5,7H,3,6,10H2,1-2H3,(H,11,13) |
| InChIKey | IVHOMJNEQXNULZ-UHFFFAOYSA-N |
| XLogP | 0.80 |
| TPSA | 63.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 180.25 |
| LogP ≤ 5 | 0.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 2-N-(6-ethylpyridazin-3-yl)propane-1,2-diamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-N-(6-ethylpyridazin-3-yl)propane-1,2-diamine?
The IUPAC name of 2-N-(6-ethylpyridazin-3-yl)propane-1,2-diamine (CID 83828270) is 2-N-(6-ethylpyridazin-3-yl)propane-1,2-diamine.
What is the SMILES notation for 2-N-(6-ethylpyridazin-3-yl)propane-1,2-diamine?
The canonical SMILES for 2-N-(6-ethylpyridazin-3-yl)propane-1,2-diamine is CCc1ccc(NC(C)CN)nn1.
What is the InChIKey of 2-N-(6-ethylpyridazin-3-yl)propane-1,2-diamine?
The InChIKey is IVHOMJNEQXNULZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H16N4/c1-3-8-4-5-9(13-12-8)11-7(2)6-10/h4-5,7H,3,6,10H2,1-2H3,(H,11,13).
What are the key properties of 2-N-(6-ethylpyridazin-3-yl)propane-1,2-diamine?
2-N-(6-ethylpyridazin-3-yl)propane-1,2-diamine has a molecular weight of 180.25 g/mol, XLogP of 0.80, 4 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-N-(6-ethylpyridazin-3-yl)propane-1,2-diamine is sourced from PubChem (CID 83828270), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).