About 6-chloro-1,3-dimethylpyrazolo[4,3-c]pyridine
6-chloro-1,3-dimethylpyrazolo[4,3-c]pyridine (PubChem CID 83828454) has the molecular formula C8H8ClN3
and a molecular weight of 181.63 g/mol. Its IUPAC name is 6-chloro-1,3-dimethylpyrazolo[4,3-c]pyridine.
Molecular Properties
| Compound Name | 6-chloro-1,3-dimethylpyrazolo[4,3-c]pyridine |
| PubChem CID | 83828454 |
| Molecular Formula | C8H8ClN3 |
| Molecular Weight | 181.63 g/mol |
| Exact Mass | 181.04 |
| IUPAC Name | 6-chloro-1,3-dimethylpyrazolo[4,3-c]pyridine |
| SMILES | Cc1nn(C)c2cc(Cl)ncc12 |
| InChI | InChI=1S/C8H8ClN3/c1-5-6-4-10-8(9)3-7(6)12(2)11-5/h3-4H,1-2H3 |
| InChIKey | IAWRLBYCYRPWGV-UHFFFAOYSA-N |
| XLogP | 1.93 |
| TPSA | 30.71 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 181.63 |
| LogP ≤ 5 | 1.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|
Analyze 6-chloro-1,3-dimethylpyrazolo[4,3-c]pyridine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-chloro-1,3-dimethylpyrazolo[4,3-c]pyridine?
The IUPAC name of 6-chloro-1,3-dimethylpyrazolo[4,3-c]pyridine (CID 83828454) is 6-chloro-1,3-dimethylpyrazolo[4,3-c]pyridine.
What is the SMILES notation for 6-chloro-1,3-dimethylpyrazolo[4,3-c]pyridine?
The canonical SMILES for 6-chloro-1,3-dimethylpyrazolo[4,3-c]pyridine is Cc1nn(C)c2cc(Cl)ncc12.
What is the InChIKey of 6-chloro-1,3-dimethylpyrazolo[4,3-c]pyridine?
The InChIKey is IAWRLBYCYRPWGV-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H8ClN3/c1-5-6-4-10-8(9)3-7(6)12(2)11-5/h3-4H,1-2H3.
What are the key properties of 6-chloro-1,3-dimethylpyrazolo[4,3-c]pyridine?
6-chloro-1,3-dimethylpyrazolo[4,3-c]pyridine has a molecular weight of 181.63 g/mol, XLogP of 1.93, 0 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 6-chloro-1,3-dimethylpyrazolo[4,3-c]pyridine is sourced from PubChem (CID 83828454), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).