4-(1,2,4-triazin-3-ylamino)butanoic acid

C7H10N4O2 — CID 83828478

IUPAC4-(1,2,4-triazin-3-ylamino)butanoic acid
SMILESO=C(O)CCCNc1nccnn1
InChIInChI=1S/C7H10N4O2/c12-6(13)2-1-3-8-7-9-4-5-10-11-7/h4-5H,1-3H2,(H,12,13)(H,8,9,11)
InChIKeyDVZRMAHZHQKLKO-UHFFFAOYSA-N
MW182.18 g/mol
LogP0.15
Rot. Bonds5

About 4-(1,2,4-triazin-3-ylamino)butanoic acid

4-(1,2,4-triazin-3-ylamino)butanoic acid (PubChem CID 83828478) has the molecular formula C7H10N4O2 and a molecular weight of 182.18 g/mol. Its IUPAC name is 4-(1,2,4-triazin-3-ylamino)butanoic acid.

Molecular Properties

Compound Name4-(1,2,4-triazin-3-ylamino)butanoic acid
PubChem CID83828478
Molecular FormulaC7H10N4O2
Molecular Weight182.18 g/mol
Exact Mass182.08
IUPAC Name4-(1,2,4-triazin-3-ylamino)butanoic acid
SMILESO=C(O)CCCNc1nccnn1
InChIInChI=1S/C7H10N4O2/c12-6(13)2-1-3-8-7-9-4-5-10-11-7/h4-5H,1-3H2,(H,12,13)(H,8,9,11)
InChIKeyDVZRMAHZHQKLKO-UHFFFAOYSA-N
XLogP0.15
TPSA88.00 Ų
H-Bond Donors2
H-Bond Acceptors5
Rotatable Bonds5
Heavy Atoms13
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500182.18
LogP ≤ 50.15
H-Bond Donors ≤ 52
H-Bond Acceptors ≤ 105

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}

Analyze 4-(1,2,4-triazin-3-ylamino)butanoic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 4-(1,2,4-triazin-3-ylamino)butanoic acid?
The IUPAC name of 4-(1,2,4-triazin-3-ylamino)butanoic acid (CID 83828478) is 4-(1,2,4-triazin-3-ylamino)butanoic acid.
What is the SMILES notation for 4-(1,2,4-triazin-3-ylamino)butanoic acid?
The canonical SMILES for 4-(1,2,4-triazin-3-ylamino)butanoic acid is O=C(O)CCCNc1nccnn1.
What is the InChIKey of 4-(1,2,4-triazin-3-ylamino)butanoic acid?
The InChIKey is DVZRMAHZHQKLKO-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H10N4O2/c12-6(13)2-1-3-8-7-9-4-5-10-11-7/h4-5H,1-3H2,(H,12,13)(H,8,9,11).
What are the key properties of 4-(1,2,4-triazin-3-ylamino)butanoic acid?
4-(1,2,4-triazin-3-ylamino)butanoic acid has a molecular weight of 182.18 g/mol, XLogP of 0.15, 5 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(1,2,4-triazin-3-ylamino)butanoic acid is sourced from PubChem (CID 83828478), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).