5-hydroxy-3,4-dihydronaphthalene-2-carboxylic acid

C11H10O3 — CID 83829420

IUPAC5-hydroxy-3,4-dihydronaphthalene-2-carboxylic acid
SMILESO=C(O)C1=Cc2cccc(O)c2CC1
InChIInChI=1S/C11H10O3/c12-10-3-1-2-7-6-8(11(13)14)4-5-9(7)10/h1-3,6,12H,4-5H2,(H,13,14)
InChIKeyZZXUHZOYRPIYDT-UHFFFAOYSA-N
MW190.20 g/mol
LogP1.81
Rot. Bonds1

About 5-hydroxy-3,4-dihydronaphthalene-2-carboxylic acid

5-hydroxy-3,4-dihydronaphthalene-2-carboxylic acid (PubChem CID 83829420) has the molecular formula C11H10O3 and a molecular weight of 190.20 g/mol. Its IUPAC name is 5-hydroxy-3,4-dihydronaphthalene-2-carboxylic acid.

Molecular Properties

Compound Name5-hydroxy-3,4-dihydronaphthalene-2-carboxylic acid
PubChem CID83829420
Molecular FormulaC11H10O3
Molecular Weight190.20 g/mol
Exact Mass190.06
IUPAC Name5-hydroxy-3,4-dihydronaphthalene-2-carboxylic acid
SMILESO=C(O)C1=Cc2cccc(O)c2CC1
InChIInChI=1S/C11H10O3/c12-10-3-1-2-7-6-8(11(13)14)4-5-9(7)10/h1-3,6,12H,4-5H2,(H,13,14)
InChIKeyZZXUHZOYRPIYDT-UHFFFAOYSA-N
XLogP1.81
TPSA57.53 Ų
H-Bond Donors2
H-Bond Acceptors2
Rotatable Bonds1
Heavy Atoms14
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500190.20
LogP ≤ 51.81
H-Bond Donors ≤ 52
H-Bond Acceptors ≤ 102

Analyze 5-hydroxy-3,4-dihydronaphthalene-2-carboxylic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 5-hydroxy-3,4-dihydronaphthalene-2-carboxylic acid?
The IUPAC name of 5-hydroxy-3,4-dihydronaphthalene-2-carboxylic acid (CID 83829420) is 5-hydroxy-3,4-dihydronaphthalene-2-carboxylic acid.
What is the SMILES notation for 5-hydroxy-3,4-dihydronaphthalene-2-carboxylic acid?
The canonical SMILES for 5-hydroxy-3,4-dihydronaphthalene-2-carboxylic acid is O=C(O)C1=Cc2cccc(O)c2CC1.
What is the InChIKey of 5-hydroxy-3,4-dihydronaphthalene-2-carboxylic acid?
The InChIKey is ZZXUHZOYRPIYDT-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H10O3/c12-10-3-1-2-7-6-8(11(13)14)4-5-9(7)10/h1-3,6,12H,4-5H2,(H,13,14).
What are the key properties of 5-hydroxy-3,4-dihydronaphthalene-2-carboxylic acid?
5-hydroxy-3,4-dihydronaphthalene-2-carboxylic acid has a molecular weight of 190.20 g/mol, XLogP of 1.81, 1 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 5-hydroxy-3,4-dihydronaphthalene-2-carboxylic acid is sourced from PubChem (CID 83829420), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).