About 2-(6-methylpyrazolo[1,5-a]pyridin-2-yl)acetic acid
2-(6-methylpyrazolo[1,5-a]pyridin-2-yl)acetic acid (PubChem CID 83829453) has the molecular formula C10H10N2O2
and a molecular weight of 190.20 g/mol. Its IUPAC name is 2-(6-methylpyrazolo[1,5-a]pyridin-2-yl)acetic acid.
Molecular Properties
| Compound Name | 2-(6-methylpyrazolo[1,5-a]pyridin-2-yl)acetic acid |
| PubChem CID | 83829453 |
| Molecular Formula | C10H10N2O2 |
| Molecular Weight | 190.20 g/mol |
| Exact Mass | 190.07 |
| IUPAC Name | 2-(6-methylpyrazolo[1,5-a]pyridin-2-yl)acetic acid |
| SMILES | Cc1ccc2cc(CC(=O)O)nn2c1 |
| InChI | InChI=1S/C10H10N2O2/c1-7-2-3-9-4-8(5-10(13)14)11-12(9)6-7/h2-4,6H,5H2,1H3,(H,13,14) |
| InChIKey | JHSGRYSCNLGZGY-UHFFFAOYSA-N |
| XLogP | 1.27 |
| TPSA | 54.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 190.20 |
| LogP ≤ 5 | 1.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 2-(6-methylpyrazolo[1,5-a]pyridin-2-yl)acetic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(6-methylpyrazolo[1,5-a]pyridin-2-yl)acetic acid?
The IUPAC name of 2-(6-methylpyrazolo[1,5-a]pyridin-2-yl)acetic acid (CID 83829453) is 2-(6-methylpyrazolo[1,5-a]pyridin-2-yl)acetic acid.
What is the SMILES notation for 2-(6-methylpyrazolo[1,5-a]pyridin-2-yl)acetic acid?
The canonical SMILES for 2-(6-methylpyrazolo[1,5-a]pyridin-2-yl)acetic acid is Cc1ccc2cc(CC(=O)O)nn2c1.
What is the InChIKey of 2-(6-methylpyrazolo[1,5-a]pyridin-2-yl)acetic acid?
The InChIKey is JHSGRYSCNLGZGY-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H10N2O2/c1-7-2-3-9-4-8(5-10(13)14)11-12(9)6-7/h2-4,6H,5H2,1H3,(H,13,14).
What are the key properties of 2-(6-methylpyrazolo[1,5-a]pyridin-2-yl)acetic acid?
2-(6-methylpyrazolo[1,5-a]pyridin-2-yl)acetic acid has a molecular weight of 190.20 g/mol, XLogP of 1.27, 2 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(6-methylpyrazolo[1,5-a]pyridin-2-yl)acetic acid is sourced from PubChem (CID 83829453), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).