C11H14N2O — CID 83829529
3-cyclopropyl-5,6,7,8-tetrahydroimidazo[1,5-a]pyridine-5-carbaldehyde (PubChem CID 83829529) has the molecular formula C11H14N2O and a molecular weight of 190.25 g/mol. Its IUPAC name is 3-cyclopropyl-5,6,7,8-tetrahydroimidazo[1,5-a]pyridine-5-carbaldehyde.
| Compound Name | 3-cyclopropyl-5,6,7,8-tetrahydroimidazo[1,5-a]pyridine-5-carbaldehyde |
|---|---|
| PubChem CID | 83829529 |
| Molecular Formula | C11H14N2O |
| Molecular Weight | 190.25 g/mol |
| Exact Mass | 190.11 |
| IUPAC Name | 3-cyclopropyl-5,6,7,8-tetrahydroimidazo[1,5-a]pyridine-5-carbaldehyde |
| SMILES | O=CC1CCCc2cnc(C3CC3)n21 |
| InChI | InChI=1S/C11H14N2O/c14-7-10-3-1-2-9-6-12-11(13(9)10)8-4-5-8/h6-8,10H,1-5H2 |
| InChIKey | XBFMRGKZWICEBL-UHFFFAOYSA-N |
| XLogP | 1.84 |
| TPSA | 34.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 190.25 |
| LogP ≤ 5 | 1.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|