2-(furo[2,3-b]pyridin-4-ylamino)acetic acid

C9H8N2O3 — CID 83829975

IUPAC2-(furo[2,3-b]pyridin-4-ylamino)acetic acid
SMILESO=C(O)CNc1ccnc2occc12
InChIInChI=1S/C9H8N2O3/c12-8(13)5-11-7-1-3-10-9-6(7)2-4-14-9/h1-4H,5H2,(H,10,11)(H,12,13)
InChIKeyZUXHUCZVNJUHTA-UHFFFAOYSA-N
MW192.17 g/mol
LogP1.32
Rot. Bonds3

About 2-(furo[2,3-b]pyridin-4-ylamino)acetic acid

2-(furo[2,3-b]pyridin-4-ylamino)acetic acid (PubChem CID 83829975) has the molecular formula C9H8N2O3 and a molecular weight of 192.17 g/mol. Its IUPAC name is 2-(furo[2,3-b]pyridin-4-ylamino)acetic acid.

Molecular Properties

Compound Name2-(furo[2,3-b]pyridin-4-ylamino)acetic acid
PubChem CID83829975
Molecular FormulaC9H8N2O3
Molecular Weight192.17 g/mol
Exact Mass192.05
IUPAC Name2-(furo[2,3-b]pyridin-4-ylamino)acetic acid
SMILESO=C(O)CNc1ccnc2occc12
InChIInChI=1S/C9H8N2O3/c12-8(13)5-11-7-1-3-10-9-6(7)2-4-14-9/h1-4H,5H2,(H,10,11)(H,12,13)
InChIKeyZUXHUCZVNJUHTA-UHFFFAOYSA-N
XLogP1.32
TPSA75.36 Ų
H-Bond Donors2
H-Bond Acceptors4
Rotatable Bonds3
Heavy Atoms14
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500192.17
LogP ≤ 51.32
H-Bond Donors ≤ 52
H-Bond Acceptors ≤ 104

Analyze 2-(furo[2,3-b]pyridin-4-ylamino)acetic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 2-(furo[2,3-b]pyridin-4-ylamino)acetic acid?
The IUPAC name of 2-(furo[2,3-b]pyridin-4-ylamino)acetic acid (CID 83829975) is 2-(furo[2,3-b]pyridin-4-ylamino)acetic acid.
What is the SMILES notation for 2-(furo[2,3-b]pyridin-4-ylamino)acetic acid?
The canonical SMILES for 2-(furo[2,3-b]pyridin-4-ylamino)acetic acid is O=C(O)CNc1ccnc2occc12.
What is the InChIKey of 2-(furo[2,3-b]pyridin-4-ylamino)acetic acid?
The InChIKey is ZUXHUCZVNJUHTA-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H8N2O3/c12-8(13)5-11-7-1-3-10-9-6(7)2-4-14-9/h1-4H,5H2,(H,10,11)(H,12,13).
What are the key properties of 2-(furo[2,3-b]pyridin-4-ylamino)acetic acid?
2-(furo[2,3-b]pyridin-4-ylamino)acetic acid has a molecular weight of 192.17 g/mol, XLogP of 1.32, 3 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(furo[2,3-b]pyridin-4-ylamino)acetic acid is sourced from PubChem (CID 83829975), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).