2-(6,7-dihydro-5H-cyclopenta[b]pyridin-2-ylamino)acetic acid

C10H12N2O2 — CID 83830034

IUPAC2-(6,7-dihydro-5H-cyclopenta[b]pyridin-2-ylamino)acetic acid
SMILESO=C(O)CNc1ccc2c(n1)CCC2
InChIInChI=1S/C10H12N2O2/c13-10(14)6-11-9-5-4-7-2-1-3-8(7)12-9/h4-5H,1-3,6H2,(H,11,12)(H,13,14)
InChIKeyKLDWDEFWTWNMPR-UHFFFAOYSA-N
MW192.22 g/mol
LogP1.07
Rot. Bonds3

About 2-(6,7-dihydro-5H-cyclopenta[b]pyridin-2-ylamino)acetic acid

2-(6,7-dihydro-5H-cyclopenta[b]pyridin-2-ylamino)acetic acid (PubChem CID 83830034) has the molecular formula C10H12N2O2 and a molecular weight of 192.22 g/mol. Its IUPAC name is 2-(6,7-dihydro-5H-cyclopenta[b]pyridin-2-ylamino)acetic acid.

Molecular Properties

Compound Name2-(6,7-dihydro-5H-cyclopenta[b]pyridin-2-ylamino)acetic acid
PubChem CID83830034
Molecular FormulaC10H12N2O2
Molecular Weight192.22 g/mol
Exact Mass192.09
IUPAC Name2-(6,7-dihydro-5H-cyclopenta[b]pyridin-2-ylamino)acetic acid
SMILESO=C(O)CNc1ccc2c(n1)CCC2
InChIInChI=1S/C10H12N2O2/c13-10(14)6-11-9-5-4-7-2-1-3-8(7)12-9/h4-5H,1-3,6H2,(H,11,12)(H,13,14)
InChIKeyKLDWDEFWTWNMPR-UHFFFAOYSA-N
XLogP1.07
TPSA62.22 Ų
H-Bond Donors2
H-Bond Acceptors3
Rotatable Bonds3
Heavy Atoms14
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500192.22
LogP ≤ 51.07
H-Bond Donors ≤ 52
H-Bond Acceptors ≤ 103

Analyze 2-(6,7-dihydro-5H-cyclopenta[b]pyridin-2-ylamino)acetic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 2-(6,7-dihydro-5H-cyclopenta[b]pyridin-2-ylamino)acetic acid?
The IUPAC name of 2-(6,7-dihydro-5H-cyclopenta[b]pyridin-2-ylamino)acetic acid (CID 83830034) is 2-(6,7-dihydro-5H-cyclopenta[b]pyridin-2-ylamino)acetic acid.
What is the SMILES notation for 2-(6,7-dihydro-5H-cyclopenta[b]pyridin-2-ylamino)acetic acid?
The canonical SMILES for 2-(6,7-dihydro-5H-cyclopenta[b]pyridin-2-ylamino)acetic acid is O=C(O)CNc1ccc2c(n1)CCC2.
What is the InChIKey of 2-(6,7-dihydro-5H-cyclopenta[b]pyridin-2-ylamino)acetic acid?
The InChIKey is KLDWDEFWTWNMPR-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H12N2O2/c13-10(14)6-11-9-5-4-7-2-1-3-8(7)12-9/h4-5H,1-3,6H2,(H,11,12)(H,13,14).
What are the key properties of 2-(6,7-dihydro-5H-cyclopenta[b]pyridin-2-ylamino)acetic acid?
2-(6,7-dihydro-5H-cyclopenta[b]pyridin-2-ylamino)acetic acid has a molecular weight of 192.22 g/mol, XLogP of 1.07, 3 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(6,7-dihydro-5H-cyclopenta[b]pyridin-2-ylamino)acetic acid is sourced from PubChem (CID 83830034), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).