About 2-(6,7-dihydro-5H-cyclopenta[b]pyridin-2-ylamino)acetic acid
2-(6,7-dihydro-5H-cyclopenta[b]pyridin-2-ylamino)acetic acid (PubChem CID 83830034) has the molecular formula C10H12N2O2
and a molecular weight of 192.22 g/mol. Its IUPAC name is 2-(6,7-dihydro-5H-cyclopenta[b]pyridin-2-ylamino)acetic acid.
Molecular Properties
| Compound Name | 2-(6,7-dihydro-5H-cyclopenta[b]pyridin-2-ylamino)acetic acid |
| PubChem CID | 83830034 |
| Molecular Formula | C10H12N2O2 |
| Molecular Weight | 192.22 g/mol |
| Exact Mass | 192.09 |
| IUPAC Name | 2-(6,7-dihydro-5H-cyclopenta[b]pyridin-2-ylamino)acetic acid |
| SMILES | O=C(O)CNc1ccc2c(n1)CCC2 |
| InChI | InChI=1S/C10H12N2O2/c13-10(14)6-11-9-5-4-7-2-1-3-8(7)12-9/h4-5H,1-3,6H2,(H,11,12)(H,13,14) |
| InChIKey | KLDWDEFWTWNMPR-UHFFFAOYSA-N |
| XLogP | 1.07 |
| TPSA | 62.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 192.22 |
| LogP ≤ 5 | 1.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 2-(6,7-dihydro-5H-cyclopenta[b]pyridin-2-ylamino)acetic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(6,7-dihydro-5H-cyclopenta[b]pyridin-2-ylamino)acetic acid?
The IUPAC name of 2-(6,7-dihydro-5H-cyclopenta[b]pyridin-2-ylamino)acetic acid (CID 83830034) is 2-(6,7-dihydro-5H-cyclopenta[b]pyridin-2-ylamino)acetic acid.
What is the SMILES notation for 2-(6,7-dihydro-5H-cyclopenta[b]pyridin-2-ylamino)acetic acid?
The canonical SMILES for 2-(6,7-dihydro-5H-cyclopenta[b]pyridin-2-ylamino)acetic acid is O=C(O)CNc1ccc2c(n1)CCC2.
What is the InChIKey of 2-(6,7-dihydro-5H-cyclopenta[b]pyridin-2-ylamino)acetic acid?
The InChIKey is KLDWDEFWTWNMPR-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H12N2O2/c13-10(14)6-11-9-5-4-7-2-1-3-8(7)12-9/h4-5H,1-3,6H2,(H,11,12)(H,13,14).
What are the key properties of 2-(6,7-dihydro-5H-cyclopenta[b]pyridin-2-ylamino)acetic acid?
2-(6,7-dihydro-5H-cyclopenta[b]pyridin-2-ylamino)acetic acid has a molecular weight of 192.22 g/mol, XLogP of 1.07, 3 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(6,7-dihydro-5H-cyclopenta[b]pyridin-2-ylamino)acetic acid is sourced from PubChem (CID 83830034), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).