C10H23N3O — CID 83831938
2-[2-[(dimethylamino)methyl]morpholin-4-yl]propan-1-amine (PubChem CID 83831938) has the molecular formula C10H23N3O and a molecular weight of 201.31 g/mol. Its IUPAC name is 2-[2-[(dimethylamino)methyl]morpholin-4-yl]propan-1-amine.
| Compound Name | 2-[2-[(dimethylamino)methyl]morpholin-4-yl]propan-1-amine |
|---|---|
| PubChem CID | 83831938 |
| Molecular Formula | C10H23N3O |
| Molecular Weight | 201.31 g/mol |
| Exact Mass | 201.18 |
| IUPAC Name | 2-[2-[(dimethylamino)methyl]morpholin-4-yl]propan-1-amine |
| SMILES | CC(CN)N1CCOC(CN(C)C)C1 |
| InChI | InChI=1S/C10H23N3O/c1-9(6-11)13-4-5-14-10(8-13)7-12(2)3/h9-10H,4-8,11H2,1-3H3 |
| InChIKey | ZGPRTEKPMOIGLJ-UHFFFAOYSA-N |
| XLogP | -0.40 |
| TPSA | 41.73 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 201.31 |
| LogP ≤ 5 | -0.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |