C13H18N2 — CID 83832116
9-methyl-1,2,3,4,4a,9a-hexahydrocarbazol-3-amine (PubChem CID 83832116) has the molecular formula C13H18N2 and a molecular weight of 202.30 g/mol. Its IUPAC name is 9-methyl-1,2,3,4,4a,9a-hexahydrocarbazol-3-amine.
| Compound Name | 9-methyl-1,2,3,4,4a,9a-hexahydrocarbazol-3-amine |
|---|---|
| PubChem CID | 83832116 |
| Molecular Formula | C13H18N2 |
| Molecular Weight | 202.30 g/mol |
| Exact Mass | 202.15 |
| IUPAC Name | 9-methyl-1,2,3,4,4a,9a-hexahydrocarbazol-3-amine |
| SMILES | CN1c2ccccc2C2CC(N)CCC21 |
| InChI | InChI=1S/C13H18N2/c1-15-12-5-3-2-4-10(12)11-8-9(14)6-7-13(11)15/h2-5,9,11,13H,6-8,14H2,1H3 |
| InChIKey | MAZBTEBIFUJNOS-UHFFFAOYSA-N |
| XLogP | 2.10 |
| TPSA | 29.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 202.30 |
| LogP ≤ 5 | 2.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |