About 4-isocyanato-8-methoxy-3,4-dihydro-2H-chromene
4-isocyanato-8-methoxy-3,4-dihydro-2H-chromene (PubChem CID 83832693) has the molecular formula C11H11NO3
and a molecular weight of 205.21 g/mol. Its IUPAC name is 4-isocyanato-8-methoxy-3,4-dihydro-2H-chromene.
Molecular Properties
| Compound Name | 4-isocyanato-8-methoxy-3,4-dihydro-2H-chromene |
| PubChem CID | 83832693 |
| Molecular Formula | C11H11NO3 |
| Molecular Weight | 205.21 g/mol |
| Exact Mass | 205.07 |
| IUPAC Name | 4-isocyanato-8-methoxy-3,4-dihydro-2H-chromene |
| SMILES | COc1cccc2c1OCCC2N=C=O |
| InChI | InChI=1S/C11H11NO3/c1-14-10-4-2-3-8-9(12-7-13)5-6-15-11(8)10/h2-4,9H,5-6H2,1H3 |
| InChIKey | LXHCKRVYEMAPNJ-UHFFFAOYSA-N |
| XLogP | 1.85 |
| TPSA | 47.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 205.21 |
| LogP ≤ 5 | 1.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isocyanate', 'substructure': 'N/A'} |
|---|
Analyze 4-isocyanato-8-methoxy-3,4-dihydro-2H-chromene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-isocyanato-8-methoxy-3,4-dihydro-2H-chromene?
The IUPAC name of 4-isocyanato-8-methoxy-3,4-dihydro-2H-chromene (CID 83832693) is 4-isocyanato-8-methoxy-3,4-dihydro-2H-chromene.
What is the SMILES notation for 4-isocyanato-8-methoxy-3,4-dihydro-2H-chromene?
The canonical SMILES for 4-isocyanato-8-methoxy-3,4-dihydro-2H-chromene is COc1cccc2c1OCCC2N=C=O.
What is the InChIKey of 4-isocyanato-8-methoxy-3,4-dihydro-2H-chromene?
The InChIKey is LXHCKRVYEMAPNJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H11NO3/c1-14-10-4-2-3-8-9(12-7-13)5-6-15-11(8)10/h2-4,9H,5-6H2,1H3.
What are the key properties of 4-isocyanato-8-methoxy-3,4-dihydro-2H-chromene?
4-isocyanato-8-methoxy-3,4-dihydro-2H-chromene has a molecular weight of 205.21 g/mol, XLogP of 1.85, 2 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 4-isocyanato-8-methoxy-3,4-dihydro-2H-chromene is sourced from PubChem (CID 83832693), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).