About 1'-methylspiro[6,7-dihydro-5H-1-benzofuran-4,2'-pyrrolidine]-3'-one
1'-methylspiro[6,7-dihydro-5H-1-benzofuran-4,2'-pyrrolidine]-3'-one (PubChem CID 83832861) has the molecular formula C12H15NO2
and a molecular weight of 205.26 g/mol. Its IUPAC name is 1'-methylspiro[6,7-dihydro-5H-1-benzofuran-4,2'-pyrrolidine]-3'-one.
Molecular Properties
| Compound Name | 1'-methylspiro[6,7-dihydro-5H-1-benzofuran-4,2'-pyrrolidine]-3'-one |
| PubChem CID | 83832861 |
| Molecular Formula | C12H15NO2 |
| Molecular Weight | 205.26 g/mol |
| Exact Mass | 205.11 |
| IUPAC Name | 1'-methylspiro[6,7-dihydro-5H-1-benzofuran-4,2'-pyrrolidine]-3'-one |
| SMILES | CN1CCC(=O)C12CCCc1occc12 |
| InChI | InChI=1S/C12H15NO2/c1-13-7-4-11(14)12(13)6-2-3-10-9(12)5-8-15-10/h5,8H,2-4,6-7H2,1H3 |
| InChIKey | PYCITZWSJKMVQU-UHFFFAOYSA-N |
| XLogP | 1.72 |
| TPSA | 33.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 205.26 |
| LogP ≤ 5 | 1.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 1'-methylspiro[6,7-dihydro-5H-1-benzofuran-4,2'-pyrrolidine]-3'-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1'-methylspiro[6,7-dihydro-5H-1-benzofuran-4,2'-pyrrolidine]-3'-one?
The IUPAC name of 1'-methylspiro[6,7-dihydro-5H-1-benzofuran-4,2'-pyrrolidine]-3'-one (CID 83832861) is 1'-methylspiro[6,7-dihydro-5H-1-benzofuran-4,2'-pyrrolidine]-3'-one.
What is the SMILES notation for 1'-methylspiro[6,7-dihydro-5H-1-benzofuran-4,2'-pyrrolidine]-3'-one?
The canonical SMILES for 1'-methylspiro[6,7-dihydro-5H-1-benzofuran-4,2'-pyrrolidine]-3'-one is CN1CCC(=O)C12CCCc1occc12.
What is the InChIKey of 1'-methylspiro[6,7-dihydro-5H-1-benzofuran-4,2'-pyrrolidine]-3'-one?
The InChIKey is PYCITZWSJKMVQU-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H15NO2/c1-13-7-4-11(14)12(13)6-2-3-10-9(12)5-8-15-10/h5,8H,2-4,6-7H2,1H3.
What are the key properties of 1'-methylspiro[6,7-dihydro-5H-1-benzofuran-4,2'-pyrrolidine]-3'-one?
1'-methylspiro[6,7-dihydro-5H-1-benzofuran-4,2'-pyrrolidine]-3'-one has a molecular weight of 205.26 g/mol, XLogP of 1.72, 0 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1'-methylspiro[6,7-dihydro-5H-1-benzofuran-4,2'-pyrrolidine]-3'-one is sourced from PubChem (CID 83832861), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).