C12H19N3 — CID 83833064
N-propan-2-yl-N-pyrrolidin-3-ylpyridin-4-amine (PubChem CID 83833064) has the molecular formula C12H19N3 and a molecular weight of 205.31 g/mol. Its IUPAC name is N-propan-2-yl-N-pyrrolidin-3-ylpyridin-4-amine.
| Compound Name | N-propan-2-yl-N-pyrrolidin-3-ylpyridin-4-amine |
|---|---|
| PubChem CID | 83833064 |
| Molecular Formula | C12H19N3 |
| Molecular Weight | 205.31 g/mol |
| Exact Mass | 205.16 |
| IUPAC Name | N-propan-2-yl-N-pyrrolidin-3-ylpyridin-4-amine |
| SMILES | CC(C)N(c1ccncc1)C1CCNC1 |
| InChI | InChI=1S/C12H19N3/c1-10(2)15(12-5-8-14-9-12)11-3-6-13-7-4-11/h3-4,6-7,10,12,14H,5,8-9H2,1-2H3 |
| InChIKey | WYTVRIKINUVIBT-UHFFFAOYSA-N |
| XLogP | 1.66 |
| TPSA | 28.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 205.31 |
| LogP ≤ 5 | 1.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |