C12H15FN2 — CID 83833422
6-fluoro-2,3,4,4a,9,9a-hexahydro-1H-carbazol-3-amine (PubChem CID 83833422) has the molecular formula C12H15FN2 and a molecular weight of 206.26 g/mol. Its IUPAC name is 6-fluoro-2,3,4,4a,9,9a-hexahydro-1H-carbazol-3-amine.
| Compound Name | 6-fluoro-2,3,4,4a,9,9a-hexahydro-1H-carbazol-3-amine |
|---|---|
| PubChem CID | 83833422 |
| Molecular Formula | C12H15FN2 |
| Molecular Weight | 206.26 g/mol |
| Exact Mass | 206.12 |
| IUPAC Name | 6-fluoro-2,3,4,4a,9,9a-hexahydro-1H-carbazol-3-amine |
| SMILES | NC1CCC2Nc3ccc(F)cc3C2C1 |
| InChI | InChI=1S/C12H15FN2/c13-7-1-3-11-9(5-7)10-6-8(14)2-4-12(10)15-11/h1,3,5,8,10,12,15H,2,4,6,14H2 |
| InChIKey | RMUCZBVJPVAAPG-UHFFFAOYSA-N |
| XLogP | 2.21 |
| TPSA | 38.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 206.26 |
| LogP ≤ 5 | 2.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |