About N'-(6,7-dihydro-5H-cyclopenta[d]pyrimidin-2-yl)-N'-methylpropane-1,3-diamine
N'-(6,7-dihydro-5H-cyclopenta[d]pyrimidin-2-yl)-N'-methylpropane-1,3-diamine (PubChem CID 83833504) has the molecular formula C11H18N4
and a molecular weight of 206.29 g/mol. Its IUPAC name is N'-(6,7-dihydro-5H-cyclopenta[d]pyrimidin-2-yl)-N'-methylpropane-1,3-diamine.
Molecular Properties
| Compound Name | N'-(6,7-dihydro-5H-cyclopenta[d]pyrimidin-2-yl)-N'-methylpropane-1,3-diamine |
| PubChem CID | 83833504 |
| Molecular Formula | C11H18N4 |
| Molecular Weight | 206.29 g/mol |
| Exact Mass | 206.15 |
| IUPAC Name | N'-(6,7-dihydro-5H-cyclopenta[d]pyrimidin-2-yl)-N'-methylpropane-1,3-diamine |
| SMILES | CN(CCCN)c1ncc2c(n1)CCC2 |
| InChI | InChI=1S/C11H18N4/c1-15(7-3-6-12)11-13-8-9-4-2-5-10(9)14-11/h8H,2-7,12H2,1H3 |
| InChIKey | PRVSKIBRZDLJEE-UHFFFAOYSA-N |
| XLogP | 0.75 |
| TPSA | 55.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 206.29 |
| LogP ≤ 5 | 0.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze N'-(6,7-dihydro-5H-cyclopenta[d]pyrimidin-2-yl)-N'-methylpropane-1,3-diamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N'-(6,7-dihydro-5H-cyclopenta[d]pyrimidin-2-yl)-N'-methylpropane-1,3-diamine?
The IUPAC name of N'-(6,7-dihydro-5H-cyclopenta[d]pyrimidin-2-yl)-N'-methylpropane-1,3-diamine (CID 83833504) is N'-(6,7-dihydro-5H-cyclopenta[d]pyrimidin-2-yl)-N'-methylpropane-1,3-diamine.
What is the SMILES notation for N'-(6,7-dihydro-5H-cyclopenta[d]pyrimidin-2-yl)-N'-methylpropane-1,3-diamine?
The canonical SMILES for N'-(6,7-dihydro-5H-cyclopenta[d]pyrimidin-2-yl)-N'-methylpropane-1,3-diamine is CN(CCCN)c1ncc2c(n1)CCC2.
What is the InChIKey of N'-(6,7-dihydro-5H-cyclopenta[d]pyrimidin-2-yl)-N'-methylpropane-1,3-diamine?
The InChIKey is PRVSKIBRZDLJEE-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H18N4/c1-15(7-3-6-12)11-13-8-9-4-2-5-10(9)14-11/h8H,2-7,12H2,1H3.
What are the key properties of N'-(6,7-dihydro-5H-cyclopenta[d]pyrimidin-2-yl)-N'-methylpropane-1,3-diamine?
N'-(6,7-dihydro-5H-cyclopenta[d]pyrimidin-2-yl)-N'-methylpropane-1,3-diamine has a molecular weight of 206.29 g/mol, XLogP of 0.75, 4 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for N'-(6,7-dihydro-5H-cyclopenta[d]pyrimidin-2-yl)-N'-methylpropane-1,3-diamine is sourced from PubChem (CID 83833504), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).