C11H17N3O — CID 83833847
N'-(6,8-dihydro-5H-pyrano[3,4-b]pyridin-2-yl)propane-1,3-diamine (PubChem CID 83833847) has the molecular formula C11H17N3O and a molecular weight of 207.28 g/mol. Its IUPAC name is N'-(6,8-dihydro-5H-pyrano[3,4-b]pyridin-2-yl)propane-1,3-diamine.
| Compound Name | N'-(6,8-dihydro-5H-pyrano[3,4-b]pyridin-2-yl)propane-1,3-diamine |
|---|---|
| PubChem CID | 83833847 |
| Molecular Formula | C11H17N3O |
| Molecular Weight | 207.28 g/mol |
| Exact Mass | 207.14 |
| IUPAC Name | N'-(6,8-dihydro-5H-pyrano[3,4-b]pyridin-2-yl)propane-1,3-diamine |
| SMILES | NCCCNc1ccc2c(n1)COCC2 |
| InChI | InChI=1S/C11H17N3O/c12-5-1-6-13-11-3-2-9-4-7-15-8-10(9)14-11/h2-3H,1,4-8,12H2,(H,13,14) |
| InChIKey | CTCJUKHJANOFMS-UHFFFAOYSA-N |
| XLogP | 0.92 |
| TPSA | 60.17 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 207.28 |
| LogP ≤ 5 | 0.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|