About 2-amino-2-(6-methyl-7,8-dihydro-5H-1,6-naphthyridin-3-yl)ethanol
2-amino-2-(6-methyl-7,8-dihydro-5H-1,6-naphthyridin-3-yl)ethanol (PubChem CID 83833852) has the molecular formula C11H17N3O
and a molecular weight of 207.28 g/mol. Its IUPAC name is 2-amino-2-(6-methyl-7,8-dihydro-5H-1,6-naphthyridin-3-yl)ethanol.
Molecular Properties
| Compound Name | 2-amino-2-(6-methyl-7,8-dihydro-5H-1,6-naphthyridin-3-yl)ethanol |
| PubChem CID | 83833852 |
| Molecular Formula | C11H17N3O |
| Molecular Weight | 207.28 g/mol |
| Exact Mass | 207.14 |
| IUPAC Name | 2-amino-2-(6-methyl-7,8-dihydro-5H-1,6-naphthyridin-3-yl)ethanol |
| SMILES | CN1CCc2ncc(C(N)CO)cc2C1 |
| InChI | InChI=1S/C11H17N3O/c1-14-3-2-11-9(6-14)4-8(5-13-11)10(12)7-15/h4-5,10,15H,2-3,6-7,12H2,1H3 |
| InChIKey | BEYBROIOMWSDIV-UHFFFAOYSA-N |
| XLogP | 0.06 |
| TPSA | 62.38 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 207.28 |
| LogP ≤ 5 | 0.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 2-amino-2-(6-methyl-7,8-dihydro-5H-1,6-naphthyridin-3-yl)ethanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-amino-2-(6-methyl-7,8-dihydro-5H-1,6-naphthyridin-3-yl)ethanol?
The IUPAC name of 2-amino-2-(6-methyl-7,8-dihydro-5H-1,6-naphthyridin-3-yl)ethanol (CID 83833852) is 2-amino-2-(6-methyl-7,8-dihydro-5H-1,6-naphthyridin-3-yl)ethanol.
What is the SMILES notation for 2-amino-2-(6-methyl-7,8-dihydro-5H-1,6-naphthyridin-3-yl)ethanol?
The canonical SMILES for 2-amino-2-(6-methyl-7,8-dihydro-5H-1,6-naphthyridin-3-yl)ethanol is CN1CCc2ncc(C(N)CO)cc2C1.
What is the InChIKey of 2-amino-2-(6-methyl-7,8-dihydro-5H-1,6-naphthyridin-3-yl)ethanol?
The InChIKey is BEYBROIOMWSDIV-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H17N3O/c1-14-3-2-11-9(6-14)4-8(5-13-11)10(12)7-15/h4-5,10,15H,2-3,6-7,12H2,1H3.
What are the key properties of 2-amino-2-(6-methyl-7,8-dihydro-5H-1,6-naphthyridin-3-yl)ethanol?
2-amino-2-(6-methyl-7,8-dihydro-5H-1,6-naphthyridin-3-yl)ethanol has a molecular weight of 207.28 g/mol, XLogP of 0.06, 2 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-amino-2-(6-methyl-7,8-dihydro-5H-1,6-naphthyridin-3-yl)ethanol is sourced from PubChem (CID 83833852), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).