About 3-[cyclopropyl(1,2,4-triazin-3-yl)amino]propanoic acid
3-[cyclopropyl(1,2,4-triazin-3-yl)amino]propanoic acid (PubChem CID 83834057) has the molecular formula C9H12N4O2
and a molecular weight of 208.22 g/mol. Its IUPAC name is 3-[cyclopropyl(1,2,4-triazin-3-yl)amino]propanoic acid.
Molecular Properties
| Compound Name | 3-[cyclopropyl(1,2,4-triazin-3-yl)amino]propanoic acid |
| PubChem CID | 83834057 |
| Molecular Formula | C9H12N4O2 |
| Molecular Weight | 208.22 g/mol |
| Exact Mass | 208.10 |
| IUPAC Name | 3-[cyclopropyl(1,2,4-triazin-3-yl)amino]propanoic acid |
| SMILES | O=C(O)CCN(c1nccnn1)C1CC1 |
| InChI | InChI=1S/C9H12N4O2/c14-8(15)3-6-13(7-1-2-7)9-10-4-5-11-12-9/h4-5,7H,1-3,6H2,(H,14,15) |
| InChIKey | RPUQDSJFRFLIBR-UHFFFAOYSA-N |
| XLogP | 0.32 |
| TPSA | 79.21 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 208.22 |
| LogP ≤ 5 | 0.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 3-[cyclopropyl(1,2,4-triazin-3-yl)amino]propanoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-[cyclopropyl(1,2,4-triazin-3-yl)amino]propanoic acid?
The IUPAC name of 3-[cyclopropyl(1,2,4-triazin-3-yl)amino]propanoic acid (CID 83834057) is 3-[cyclopropyl(1,2,4-triazin-3-yl)amino]propanoic acid.
What is the SMILES notation for 3-[cyclopropyl(1,2,4-triazin-3-yl)amino]propanoic acid?
The canonical SMILES for 3-[cyclopropyl(1,2,4-triazin-3-yl)amino]propanoic acid is O=C(O)CCN(c1nccnn1)C1CC1.
What is the InChIKey of 3-[cyclopropyl(1,2,4-triazin-3-yl)amino]propanoic acid?
The InChIKey is RPUQDSJFRFLIBR-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H12N4O2/c14-8(15)3-6-13(7-1-2-7)9-10-4-5-11-12-9/h4-5,7H,1-3,6H2,(H,14,15).
What are the key properties of 3-[cyclopropyl(1,2,4-triazin-3-yl)amino]propanoic acid?
3-[cyclopropyl(1,2,4-triazin-3-yl)amino]propanoic acid has a molecular weight of 208.22 g/mol, XLogP of 0.32, 5 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[cyclopropyl(1,2,4-triazin-3-yl)amino]propanoic acid is sourced from PubChem (CID 83834057), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).