3-(methylamino)-1,2-benzothiazole-5-carboxylic acid

C9H8N2O2S — CID 83834075

IUPAC3-(methylamino)-1,2-benzothiazole-5-carboxylic acid
SMILESCNc1nsc2ccc(C(=O)O)cc12
InChIInChI=1S/C9H8N2O2S/c1-10-8-6-4-5(9(12)13)2-3-7(6)14-11-8/h2-4H,1H3,(H,10,11)(H,12,13)
InChIKeyALYJDXKYHLYTGT-UHFFFAOYSA-N
MW208.24 g/mol
LogP2.04
Rot. Bonds2

About 3-(methylamino)-1,2-benzothiazole-5-carboxylic acid

3-(methylamino)-1,2-benzothiazole-5-carboxylic acid (PubChem CID 83834075) has the molecular formula C9H8N2O2S and a molecular weight of 208.24 g/mol. Its IUPAC name is 3-(methylamino)-1,2-benzothiazole-5-carboxylic acid.

Molecular Properties

Compound Name3-(methylamino)-1,2-benzothiazole-5-carboxylic acid
PubChem CID83834075
Molecular FormulaC9H8N2O2S
Molecular Weight208.24 g/mol
Exact Mass208.03
IUPAC Name3-(methylamino)-1,2-benzothiazole-5-carboxylic acid
SMILESCNc1nsc2ccc(C(=O)O)cc12
InChIInChI=1S/C9H8N2O2S/c1-10-8-6-4-5(9(12)13)2-3-7(6)14-11-8/h2-4H,1H3,(H,10,11)(H,12,13)
InChIKeyALYJDXKYHLYTGT-UHFFFAOYSA-N
XLogP2.04
TPSA62.22 Ų
H-Bond Donors2
H-Bond Acceptors4
Rotatable Bonds2
Heavy Atoms14
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500208.24
LogP ≤ 52.04
H-Bond Donors ≤ 52
H-Bond Acceptors ≤ 104

Analyze 3-(methylamino)-1,2-benzothiazole-5-carboxylic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 3-(methylamino)-1,2-benzothiazole-5-carboxylic acid?
The IUPAC name of 3-(methylamino)-1,2-benzothiazole-5-carboxylic acid (CID 83834075) is 3-(methylamino)-1,2-benzothiazole-5-carboxylic acid.
What is the SMILES notation for 3-(methylamino)-1,2-benzothiazole-5-carboxylic acid?
The canonical SMILES for 3-(methylamino)-1,2-benzothiazole-5-carboxylic acid is CNc1nsc2ccc(C(=O)O)cc12.
What is the InChIKey of 3-(methylamino)-1,2-benzothiazole-5-carboxylic acid?
The InChIKey is ALYJDXKYHLYTGT-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H8N2O2S/c1-10-8-6-4-5(9(12)13)2-3-7(6)14-11-8/h2-4H,1H3,(H,10,11)(H,12,13).
What are the key properties of 3-(methylamino)-1,2-benzothiazole-5-carboxylic acid?
3-(methylamino)-1,2-benzothiazole-5-carboxylic acid has a molecular weight of 208.24 g/mol, XLogP of 2.04, 2 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(methylamino)-1,2-benzothiazole-5-carboxylic acid is sourced from PubChem (CID 83834075), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).