C9H12N4S — CID 83834252
N'-([1,3]thiazolo[5,4-b]pyridin-5-yl)propane-1,3-diamine (PubChem CID 83834252) has the molecular formula C9H12N4S and a molecular weight of 208.29 g/mol. Its IUPAC name is N'-([1,3]thiazolo[5,4-b]pyridin-5-yl)propane-1,3-diamine.
| Compound Name | N'-([1,3]thiazolo[5,4-b]pyridin-5-yl)propane-1,3-diamine |
|---|---|
| PubChem CID | 83834252 |
| Molecular Formula | C9H12N4S |
| Molecular Weight | 208.29 g/mol |
| Exact Mass | 208.08 |
| IUPAC Name | N'-([1,3]thiazolo[5,4-b]pyridin-5-yl)propane-1,3-diamine |
| SMILES | NCCCNc1ccc2ncsc2n1 |
| InChI | InChI=1S/C9H12N4S/c10-4-1-5-11-8-3-2-7-9(13-8)14-6-12-7/h2-3,6H,1,4-5,10H2,(H,11,13) |
| InChIKey | QZAORCLADFWAHY-UHFFFAOYSA-N |
| XLogP | 1.45 |
| TPSA | 63.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 208.29 |
| LogP ≤ 5 | 1.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|