About 2-cyclopropyl-N-methyl-2-(5-propan-2-yl-1,2-oxazol-3-yl)ethanamine
2-cyclopropyl-N-methyl-2-(5-propan-2-yl-1,2-oxazol-3-yl)ethanamine (PubChem CID 83834276) has the molecular formula C12H20N2O
and a molecular weight of 208.31 g/mol. Its IUPAC name is 2-cyclopropyl-N-methyl-2-(5-propan-2-yl-1,2-oxazol-3-yl)ethanamine.
Molecular Properties
| Compound Name | 2-cyclopropyl-N-methyl-2-(5-propan-2-yl-1,2-oxazol-3-yl)ethanamine |
| PubChem CID | 83834276 |
| Molecular Formula | C12H20N2O |
| Molecular Weight | 208.31 g/mol |
| Exact Mass | 208.16 |
| IUPAC Name | 2-cyclopropyl-N-methyl-2-(5-propan-2-yl-1,2-oxazol-3-yl)ethanamine |
| SMILES | CNCC(c1cc(C(C)C)on1)C1CC1 |
| InChI | InChI=1S/C12H20N2O/c1-8(2)12-6-11(14-15-12)10(7-13-3)9-4-5-9/h6,8-10,13H,4-5,7H2,1-3H3 |
| InChIKey | QDEALRFYFRNMIB-UHFFFAOYSA-N |
| XLogP | 2.51 |
| TPSA | 38.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 208.31 |
| LogP ≤ 5 | 2.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 2-cyclopropyl-N-methyl-2-(5-propan-2-yl-1,2-oxazol-3-yl)ethanamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-cyclopropyl-N-methyl-2-(5-propan-2-yl-1,2-oxazol-3-yl)ethanamine?
The IUPAC name of 2-cyclopropyl-N-methyl-2-(5-propan-2-yl-1,2-oxazol-3-yl)ethanamine (CID 83834276) is 2-cyclopropyl-N-methyl-2-(5-propan-2-yl-1,2-oxazol-3-yl)ethanamine.
What is the SMILES notation for 2-cyclopropyl-N-methyl-2-(5-propan-2-yl-1,2-oxazol-3-yl)ethanamine?
The canonical SMILES for 2-cyclopropyl-N-methyl-2-(5-propan-2-yl-1,2-oxazol-3-yl)ethanamine is CNCC(c1cc(C(C)C)on1)C1CC1.
What is the InChIKey of 2-cyclopropyl-N-methyl-2-(5-propan-2-yl-1,2-oxazol-3-yl)ethanamine?
The InChIKey is QDEALRFYFRNMIB-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H20N2O/c1-8(2)12-6-11(14-15-12)10(7-13-3)9-4-5-9/h6,8-10,13H,4-5,7H2,1-3H3.
What are the key properties of 2-cyclopropyl-N-methyl-2-(5-propan-2-yl-1,2-oxazol-3-yl)ethanamine?
2-cyclopropyl-N-methyl-2-(5-propan-2-yl-1,2-oxazol-3-yl)ethanamine has a molecular weight of 208.31 g/mol, XLogP of 2.51, 5 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-cyclopropyl-N-methyl-2-(5-propan-2-yl-1,2-oxazol-3-yl)ethanamine is sourced from PubChem (CID 83834276), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).