About N'-(6-chloro-1,3-benzoxazol-2-yl)ethane-1,2-diamine
N'-(6-chloro-1,3-benzoxazol-2-yl)ethane-1,2-diamine (PubChem CID 83835155) has the molecular formula C9H10ClN3O
and a molecular weight of 211.65 g/mol. Its IUPAC name is N'-(6-chloro-1,3-benzoxazol-2-yl)ethane-1,2-diamine.
Molecular Properties
| Compound Name | N'-(6-chloro-1,3-benzoxazol-2-yl)ethane-1,2-diamine |
| PubChem CID | 83835155 |
| Molecular Formula | C9H10ClN3O |
| Molecular Weight | 211.65 g/mol |
| Exact Mass | 211.05 |
| IUPAC Name | N'-(6-chloro-1,3-benzoxazol-2-yl)ethane-1,2-diamine |
| SMILES | NCCNc1nc2ccc(Cl)cc2o1 |
| InChI | InChI=1S/C9H10ClN3O/c10-6-1-2-7-8(5-6)14-9(13-7)12-4-3-11/h1-2,5H,3-4,11H2,(H,12,13) |
| InChIKey | MIFZSFOXMHLGCV-UHFFFAOYSA-N |
| XLogP | 1.85 |
| TPSA | 64.08 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 211.65 |
| LogP ≤ 5 | 1.85 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze N'-(6-chloro-1,3-benzoxazol-2-yl)ethane-1,2-diamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N'-(6-chloro-1,3-benzoxazol-2-yl)ethane-1,2-diamine?
The IUPAC name of N'-(6-chloro-1,3-benzoxazol-2-yl)ethane-1,2-diamine (CID 83835155) is N'-(6-chloro-1,3-benzoxazol-2-yl)ethane-1,2-diamine.
What is the SMILES notation for N'-(6-chloro-1,3-benzoxazol-2-yl)ethane-1,2-diamine?
The canonical SMILES for N'-(6-chloro-1,3-benzoxazol-2-yl)ethane-1,2-diamine is NCCNc1nc2ccc(Cl)cc2o1.
What is the InChIKey of N'-(6-chloro-1,3-benzoxazol-2-yl)ethane-1,2-diamine?
The InChIKey is MIFZSFOXMHLGCV-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H10ClN3O/c10-6-1-2-7-8(5-6)14-9(13-7)12-4-3-11/h1-2,5H,3-4,11H2,(H,12,13).
What are the key properties of N'-(6-chloro-1,3-benzoxazol-2-yl)ethane-1,2-diamine?
N'-(6-chloro-1,3-benzoxazol-2-yl)ethane-1,2-diamine has a molecular weight of 211.65 g/mol, XLogP of 1.85, 3 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for N'-(6-chloro-1,3-benzoxazol-2-yl)ethane-1,2-diamine is sourced from PubChem (CID 83835155), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).