About 5-bromo-1,2,3,4-tetrahydroquinoxaline
5-bromo-1,2,3,4-tetrahydroquinoxaline (PubChem CID 83835328) has the molecular formula C8H9BrN2
and a molecular weight of 213.08 g/mol. Its IUPAC name is 5-bromo-1,2,3,4-tetrahydroquinoxaline.
Molecular Properties
| Compound Name | 5-bromo-1,2,3,4-tetrahydroquinoxaline |
| PubChem CID | 83835328 |
| Molecular Formula | C8H9BrN2 |
| Molecular Weight | 213.08 g/mol |
| Exact Mass | 211.99 |
| IUPAC Name | 5-bromo-1,2,3,4-tetrahydroquinoxaline |
| SMILES | Brc1cccc2c1NCCN2 |
| InChI | InChI=1S/C8H9BrN2/c9-6-2-1-3-7-8(6)11-5-4-10-7/h1-3,10-11H,4-5H2 |
| InChIKey | FIKDZJTWPVLQDX-UHFFFAOYSA-N |
| XLogP | 2.29 |
| TPSA | 24.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 213.08 |
| LogP ≤ 5 | 2.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 5-bromo-1,2,3,4-tetrahydroquinoxaline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-bromo-1,2,3,4-tetrahydroquinoxaline?
The IUPAC name of 5-bromo-1,2,3,4-tetrahydroquinoxaline (CID 83835328) is 5-bromo-1,2,3,4-tetrahydroquinoxaline.
What is the SMILES notation for 5-bromo-1,2,3,4-tetrahydroquinoxaline?
The canonical SMILES for 5-bromo-1,2,3,4-tetrahydroquinoxaline is Brc1cccc2c1NCCN2.
What is the InChIKey of 5-bromo-1,2,3,4-tetrahydroquinoxaline?
The InChIKey is FIKDZJTWPVLQDX-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H9BrN2/c9-6-2-1-3-7-8(6)11-5-4-10-7/h1-3,10-11H,4-5H2.
What are the key properties of 5-bromo-1,2,3,4-tetrahydroquinoxaline?
5-bromo-1,2,3,4-tetrahydroquinoxaline has a molecular weight of 213.08 g/mol, XLogP of 2.29, 0 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 5-bromo-1,2,3,4-tetrahydroquinoxaline is sourced from PubChem (CID 83835328), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).