About 7-bromo-[1,3]thiazolo[4,5-b]pyridine
7-bromo-[1,3]thiazolo[4,5-b]pyridine (PubChem CID 83835576) has the molecular formula C6H3BrN2S
and a molecular weight of 215.08 g/mol. Its IUPAC name is 7-bromo-[1,3]thiazolo[4,5-b]pyridine.
Molecular Properties
| Compound Name | 7-bromo-[1,3]thiazolo[4,5-b]pyridine |
| PubChem CID | 83835576 |
| Molecular Formula | C6H3BrN2S |
| Molecular Weight | 215.08 g/mol |
| Exact Mass | 213.92 |
| IUPAC Name | 7-bromo-[1,3]thiazolo[4,5-b]pyridine |
| SMILES | Brc1ccnc2ncsc12 |
| InChI | InChI=1S/C6H3BrN2S/c7-4-1-2-8-6-5(4)10-3-9-6/h1-3H |
| InChIKey | XFSALLFRFKYYPV-UHFFFAOYSA-N |
| XLogP | 2.45 |
| TPSA | 25.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 215.08 |
| LogP ≤ 5 | 2.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 7-bromo-[1,3]thiazolo[4,5-b]pyridine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 7-bromo-[1,3]thiazolo[4,5-b]pyridine?
The IUPAC name of 7-bromo-[1,3]thiazolo[4,5-b]pyridine (CID 83835576) is 7-bromo-[1,3]thiazolo[4,5-b]pyridine.
What is the SMILES notation for 7-bromo-[1,3]thiazolo[4,5-b]pyridine?
The canonical SMILES for 7-bromo-[1,3]thiazolo[4,5-b]pyridine is Brc1ccnc2ncsc12.
What is the InChIKey of 7-bromo-[1,3]thiazolo[4,5-b]pyridine?
The InChIKey is XFSALLFRFKYYPV-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H3BrN2S/c7-4-1-2-8-6-5(4)10-3-9-6/h1-3H.
What are the key properties of 7-bromo-[1,3]thiazolo[4,5-b]pyridine?
7-bromo-[1,3]thiazolo[4,5-b]pyridine has a molecular weight of 215.08 g/mol, XLogP of 2.45, 0 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 7-bromo-[1,3]thiazolo[4,5-b]pyridine is sourced from PubChem (CID 83835576), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).