About 3-cyclohexylimidazo[1,5-a]pyridin-7-amine
3-cyclohexylimidazo[1,5-a]pyridin-7-amine (PubChem CID 83835629) has the molecular formula C13H17N3
and a molecular weight of 215.30 g/mol. Its IUPAC name is 3-cyclohexylimidazo[1,5-a]pyridin-7-amine.
Molecular Properties
| Compound Name | 3-cyclohexylimidazo[1,5-a]pyridin-7-amine |
| PubChem CID | 83835629 |
| Molecular Formula | C13H17N3 |
| Molecular Weight | 215.30 g/mol |
| Exact Mass | 215.14 |
| IUPAC Name | 3-cyclohexylimidazo[1,5-a]pyridin-7-amine |
| SMILES | Nc1ccn2c(C3CCCCC3)ncc2c1 |
| InChI | InChI=1S/C13H17N3/c14-11-6-7-16-12(8-11)9-15-13(16)10-4-2-1-3-5-10/h6-10H,1-5,14H2 |
| InChIKey | QXEZVZLCHJBSMW-UHFFFAOYSA-N |
| XLogP | 2.96 |
| TPSA | 43.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 215.30 |
| LogP ≤ 5 | 2.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 3-cyclohexylimidazo[1,5-a]pyridin-7-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-cyclohexylimidazo[1,5-a]pyridin-7-amine?
The IUPAC name of 3-cyclohexylimidazo[1,5-a]pyridin-7-amine (CID 83835629) is 3-cyclohexylimidazo[1,5-a]pyridin-7-amine.
What is the SMILES notation for 3-cyclohexylimidazo[1,5-a]pyridin-7-amine?
The canonical SMILES for 3-cyclohexylimidazo[1,5-a]pyridin-7-amine is Nc1ccn2c(C3CCCCC3)ncc2c1.
What is the InChIKey of 3-cyclohexylimidazo[1,5-a]pyridin-7-amine?
The InChIKey is QXEZVZLCHJBSMW-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H17N3/c14-11-6-7-16-12(8-11)9-15-13(16)10-4-2-1-3-5-10/h6-10H,1-5,14H2.
What are the key properties of 3-cyclohexylimidazo[1,5-a]pyridin-7-amine?
3-cyclohexylimidazo[1,5-a]pyridin-7-amine has a molecular weight of 215.30 g/mol, XLogP of 2.96, 1 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-cyclohexylimidazo[1,5-a]pyridin-7-amine is sourced from PubChem (CID 83835629), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).