C13H17N3 — CID 83835706
3,6-dimethyl-1-pyrrolidin-3-ylimidazo[1,5-a]pyridine (PubChem CID 83835706) has the molecular formula C13H17N3 and a molecular weight of 215.30 g/mol. Its IUPAC name is 3,6-dimethyl-1-pyrrolidin-3-ylimidazo[1,5-a]pyridine.
| Compound Name | 3,6-dimethyl-1-pyrrolidin-3-ylimidazo[1,5-a]pyridine |
|---|---|
| PubChem CID | 83835706 |
| Molecular Formula | C13H17N3 |
| Molecular Weight | 215.30 g/mol |
| Exact Mass | 215.14 |
| IUPAC Name | 3,6-dimethyl-1-pyrrolidin-3-ylimidazo[1,5-a]pyridine |
| SMILES | Cc1ccc2c(C3CCNC3)nc(C)n2c1 |
| InChI | InChI=1S/C13H17N3/c1-9-3-4-12-13(11-5-6-14-7-11)15-10(2)16(12)8-9/h3-4,8,11,14H,5-7H2,1-2H3 |
| InChIKey | NGNXTSFSGPBBRG-UHFFFAOYSA-N |
| XLogP | 2.03 |
| TPSA | 29.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 215.30 |
| LogP ≤ 5 | 2.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |