C12H16N4 — CID 83835946
3-methyl-6-piperidin-3-yl-[1,2,4]triazolo[4,3-a]pyridine (PubChem CID 83835946) has the molecular formula C12H16N4 and a molecular weight of 216.29 g/mol. Its IUPAC name is 3-methyl-6-piperidin-3-yl-[1,2,4]triazolo[4,3-a]pyridine.
| Compound Name | 3-methyl-6-piperidin-3-yl-[1,2,4]triazolo[4,3-a]pyridine |
|---|---|
| PubChem CID | 83835946 |
| Molecular Formula | C12H16N4 |
| Molecular Weight | 216.29 g/mol |
| Exact Mass | 216.14 |
| IUPAC Name | 3-methyl-6-piperidin-3-yl-[1,2,4]triazolo[4,3-a]pyridine |
| SMILES | Cc1nnc2ccc(C3CCCNC3)cn12 |
| InChI | InChI=1S/C12H16N4/c1-9-14-15-12-5-4-11(8-16(9)12)10-3-2-6-13-7-10/h4-5,8,10,13H,2-3,6-7H2,1H3 |
| InChIKey | KKEMZXQXMTXPBP-UHFFFAOYSA-N |
| XLogP | 1.50 |
| TPSA | 42.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 216.29 |
| LogP ≤ 5 | 1.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |