About 3-cyclopropyl-1-nitroimidazo[1,5-a]pyridin-8-amine
3-cyclopropyl-1-nitroimidazo[1,5-a]pyridin-8-amine (PubChem CID 83836399) has the molecular formula C10H10N4O2
and a molecular weight of 218.22 g/mol. Its IUPAC name is 3-cyclopropyl-1-nitroimidazo[1,5-a]pyridin-8-amine.
Molecular Properties
| Compound Name | 3-cyclopropyl-1-nitroimidazo[1,5-a]pyridin-8-amine |
| PubChem CID | 83836399 |
| Molecular Formula | C10H10N4O2 |
| Molecular Weight | 218.22 g/mol |
| Exact Mass | 218.08 |
| IUPAC Name | 3-cyclopropyl-1-nitroimidazo[1,5-a]pyridin-8-amine |
| SMILES | Nc1cccn2c(C3CC3)nc([N+](=O)[O-])c12 |
| InChI | InChI=1S/C10H10N4O2/c11-7-2-1-5-13-8(7)10(14(15)16)12-9(13)6-3-4-6/h1-2,5-6H,3-4,11H2 |
| InChIKey | NXTCOACBLMXJSV-UHFFFAOYSA-N |
| XLogP | 1.70 |
| TPSA | 86.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 218.22 |
| LogP ≤ 5 | 1.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 3-cyclopropyl-1-nitroimidazo[1,5-a]pyridin-8-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-cyclopropyl-1-nitroimidazo[1,5-a]pyridin-8-amine?
The IUPAC name of 3-cyclopropyl-1-nitroimidazo[1,5-a]pyridin-8-amine (CID 83836399) is 3-cyclopropyl-1-nitroimidazo[1,5-a]pyridin-8-amine.
What is the SMILES notation for 3-cyclopropyl-1-nitroimidazo[1,5-a]pyridin-8-amine?
The canonical SMILES for 3-cyclopropyl-1-nitroimidazo[1,5-a]pyridin-8-amine is Nc1cccn2c(C3CC3)nc([N+](=O)[O-])c12.
What is the InChIKey of 3-cyclopropyl-1-nitroimidazo[1,5-a]pyridin-8-amine?
The InChIKey is NXTCOACBLMXJSV-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H10N4O2/c11-7-2-1-5-13-8(7)10(14(15)16)12-9(13)6-3-4-6/h1-2,5-6H,3-4,11H2.
What are the key properties of 3-cyclopropyl-1-nitroimidazo[1,5-a]pyridin-8-amine?
3-cyclopropyl-1-nitroimidazo[1,5-a]pyridin-8-amine has a molecular weight of 218.22 g/mol, XLogP of 1.70, 2 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 3-cyclopropyl-1-nitroimidazo[1,5-a]pyridin-8-amine is sourced from PubChem (CID 83836399), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).