About 3-methyl-N-phenyl-1,3-benzothiazol-2-imine
3-methyl-N-phenyl-1,3-benzothiazol-2-imine (PubChem CID 838370) has the molecular formula C14H12N2S
and a molecular weight of 240.33 g/mol. Its IUPAC name is 3-methyl-N-phenyl-1,3-benzothiazol-2-imine.
Molecular Properties
| Compound Name | 3-methyl-N-phenyl-1,3-benzothiazol-2-imine |
| PubChem CID | 838370 |
| Molecular Formula | C14H12N2S |
| Molecular Weight | 240.33 g/mol |
| Exact Mass | 240.07 |
| IUPAC Name | 3-methyl-N-phenyl-1,3-benzothiazol-2-imine |
| SMILES | Cn1/c(=N/c2ccccc2)sc2ccccc21 |
| InChI | InChI=1S/C14H12N2S/c1-16-12-9-5-6-10-13(12)17-14(16)15-11-7-3-2-4-8-11/h2-10H,1H3/b15-14- |
| InChIKey | VBSAAKLJRDUJHZ-PFONDFGASA-N |
| XLogP | 3.47 |
| TPSA | 17.29 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 240.33 |
| LogP ≤ 5 | 3.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 3-methyl-N-phenyl-1,3-benzothiazol-2-imine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-methyl-N-phenyl-1,3-benzothiazol-2-imine?
The IUPAC name of 3-methyl-N-phenyl-1,3-benzothiazol-2-imine (CID 838370) is 3-methyl-N-phenyl-1,3-benzothiazol-2-imine.
What is the SMILES notation for 3-methyl-N-phenyl-1,3-benzothiazol-2-imine?
The canonical SMILES for 3-methyl-N-phenyl-1,3-benzothiazol-2-imine is Cn1/c(=N/c2ccccc2)sc2ccccc21.
What is the InChIKey of 3-methyl-N-phenyl-1,3-benzothiazol-2-imine?
The InChIKey is VBSAAKLJRDUJHZ-PFONDFGASA-N. The full InChI is InChI=1S/C14H12N2S/c1-16-12-9-5-6-10-13(12)17-14(16)15-11-7-3-2-4-8-11/h2-10H,1H3/b15-14-.
What are the key properties of 3-methyl-N-phenyl-1,3-benzothiazol-2-imine?
3-methyl-N-phenyl-1,3-benzothiazol-2-imine has a molecular weight of 240.33 g/mol, XLogP of 3.47, 1 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-methyl-N-phenyl-1,3-benzothiazol-2-imine is sourced from PubChem (CID 838370), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).