About N'-(4-methoxy-6,7-dihydro-5H-cyclopenta[d]pyrimidin-2-yl)propane-1,3-diamine
N'-(4-methoxy-6,7-dihydro-5H-cyclopenta[d]pyrimidin-2-yl)propane-1,3-diamine (PubChem CID 83838853) has the molecular formula C11H18N4O
and a molecular weight of 222.29 g/mol. Its IUPAC name is N'-(4-methoxy-6,7-dihydro-5H-cyclopenta[d]pyrimidin-2-yl)propane-1,3-diamine.
Molecular Properties
| Compound Name | N'-(4-methoxy-6,7-dihydro-5H-cyclopenta[d]pyrimidin-2-yl)propane-1,3-diamine |
| PubChem CID | 83838853 |
| Molecular Formula | C11H18N4O |
| Molecular Weight | 222.29 g/mol |
| Exact Mass | 222.15 |
| IUPAC Name | N'-(4-methoxy-6,7-dihydro-5H-cyclopenta[d]pyrimidin-2-yl)propane-1,3-diamine |
| SMILES | COc1nc(NCCCN)nc2c1CCC2 |
| InChI | InChI=1S/C11H18N4O/c1-16-10-8-4-2-5-9(8)14-11(15-10)13-7-3-6-12/h2-7,12H2,1H3,(H,13,14,15) |
| InChIKey | WTXXJDRLKUWFNC-UHFFFAOYSA-N |
| XLogP | 0.73 |
| TPSA | 73.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 222.29 |
| LogP ≤ 5 | 0.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze N'-(4-methoxy-6,7-dihydro-5H-cyclopenta[d]pyrimidin-2-yl)propane-1,3-diamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N'-(4-methoxy-6,7-dihydro-5H-cyclopenta[d]pyrimidin-2-yl)propane-1,3-diamine?
The IUPAC name of N'-(4-methoxy-6,7-dihydro-5H-cyclopenta[d]pyrimidin-2-yl)propane-1,3-diamine (CID 83838853) is N'-(4-methoxy-6,7-dihydro-5H-cyclopenta[d]pyrimidin-2-yl)propane-1,3-diamine.
What is the SMILES notation for N'-(4-methoxy-6,7-dihydro-5H-cyclopenta[d]pyrimidin-2-yl)propane-1,3-diamine?
The canonical SMILES for N'-(4-methoxy-6,7-dihydro-5H-cyclopenta[d]pyrimidin-2-yl)propane-1,3-diamine is COc1nc(NCCCN)nc2c1CCC2.
What is the InChIKey of N'-(4-methoxy-6,7-dihydro-5H-cyclopenta[d]pyrimidin-2-yl)propane-1,3-diamine?
The InChIKey is WTXXJDRLKUWFNC-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H18N4O/c1-16-10-8-4-2-5-9(8)14-11(15-10)13-7-3-6-12/h2-7,12H2,1H3,(H,13,14,15).
What are the key properties of N'-(4-methoxy-6,7-dihydro-5H-cyclopenta[d]pyrimidin-2-yl)propane-1,3-diamine?
N'-(4-methoxy-6,7-dihydro-5H-cyclopenta[d]pyrimidin-2-yl)propane-1,3-diamine has a molecular weight of 222.29 g/mol, XLogP of 0.73, 5 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for N'-(4-methoxy-6,7-dihydro-5H-cyclopenta[d]pyrimidin-2-yl)propane-1,3-diamine is sourced from PubChem (CID 83838853), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).