About 3-[(4-methyl-5,7-dihydrofuro[3,4-d]pyrimidin-2-yl)amino]propanoic acid
3-[(4-methyl-5,7-dihydrofuro[3,4-d]pyrimidin-2-yl)amino]propanoic acid (PubChem CID 83839024) has the molecular formula C10H13N3O3
and a molecular weight of 223.23 g/mol. Its IUPAC name is 3-[(4-methyl-5,7-dihydrofuro[3,4-d]pyrimidin-2-yl)amino]propanoic acid.
Molecular Properties
| Compound Name | 3-[(4-methyl-5,7-dihydrofuro[3,4-d]pyrimidin-2-yl)amino]propanoic acid |
| PubChem CID | 83839024 |
| Molecular Formula | C10H13N3O3 |
| Molecular Weight | 223.23 g/mol |
| Exact Mass | 223.10 |
| IUPAC Name | 3-[(4-methyl-5,7-dihydrofuro[3,4-d]pyrimidin-2-yl)amino]propanoic acid |
| SMILES | Cc1nc(NCCC(=O)O)nc2c1COC2 |
| InChI | InChI=1S/C10H13N3O3/c1-6-7-4-16-5-8(7)13-10(12-6)11-3-2-9(14)15/h2-5H2,1H3,(H,14,15)(H,11,12,13) |
| InChIKey | ODEIPZHYOINIGR-UHFFFAOYSA-N |
| XLogP | 0.70 |
| TPSA | 84.34 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 223.23 |
| LogP ≤ 5 | 0.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 3-[(4-methyl-5,7-dihydrofuro[3,4-d]pyrimidin-2-yl)amino]propanoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-[(4-methyl-5,7-dihydrofuro[3,4-d]pyrimidin-2-yl)amino]propanoic acid?
The IUPAC name of 3-[(4-methyl-5,7-dihydrofuro[3,4-d]pyrimidin-2-yl)amino]propanoic acid (CID 83839024) is 3-[(4-methyl-5,7-dihydrofuro[3,4-d]pyrimidin-2-yl)amino]propanoic acid.
What is the SMILES notation for 3-[(4-methyl-5,7-dihydrofuro[3,4-d]pyrimidin-2-yl)amino]propanoic acid?
The canonical SMILES for 3-[(4-methyl-5,7-dihydrofuro[3,4-d]pyrimidin-2-yl)amino]propanoic acid is Cc1nc(NCCC(=O)O)nc2c1COC2.
What is the InChIKey of 3-[(4-methyl-5,7-dihydrofuro[3,4-d]pyrimidin-2-yl)amino]propanoic acid?
The InChIKey is ODEIPZHYOINIGR-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H13N3O3/c1-6-7-4-16-5-8(7)13-10(12-6)11-3-2-9(14)15/h2-5H2,1H3,(H,14,15)(H,11,12,13).
What are the key properties of 3-[(4-methyl-5,7-dihydrofuro[3,4-d]pyrimidin-2-yl)amino]propanoic acid?
3-[(4-methyl-5,7-dihydrofuro[3,4-d]pyrimidin-2-yl)amino]propanoic acid has a molecular weight of 223.23 g/mol, XLogP of 0.70, 4 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[(4-methyl-5,7-dihydrofuro[3,4-d]pyrimidin-2-yl)amino]propanoic acid is sourced from PubChem (CID 83839024), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).