About 2-[(3-methyl-[1,2]thiazolo[4,5-d]pyrimidin-7-yl)amino]acetic acid
2-[(3-methyl-[1,2]thiazolo[4,5-d]pyrimidin-7-yl)amino]acetic acid (PubChem CID 83839373) has the molecular formula C8H8N4O2S
and a molecular weight of 224.25 g/mol. Its IUPAC name is 2-[(3-methyl-[1,2]thiazolo[4,5-d]pyrimidin-7-yl)amino]acetic acid.
Molecular Properties
| Compound Name | 2-[(3-methyl-[1,2]thiazolo[4,5-d]pyrimidin-7-yl)amino]acetic acid |
| PubChem CID | 83839373 |
| Molecular Formula | C8H8N4O2S |
| Molecular Weight | 224.25 g/mol |
| Exact Mass | 224.04 |
| IUPAC Name | 2-[(3-methyl-[1,2]thiazolo[4,5-d]pyrimidin-7-yl)amino]acetic acid |
| SMILES | Cc1nsc2c(NCC(=O)O)ncnc12 |
| InChI | InChI=1S/C8H8N4O2S/c1-4-6-7(15-12-4)8(11-3-10-6)9-2-5(13)14/h3H,2H2,1H3,(H,13,14)(H,9,10,11) |
| InChIKey | LNGYBTNALUSVHH-UHFFFAOYSA-N |
| XLogP | 0.89 |
| TPSA | 88.00 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 224.25 |
| LogP ≤ 5 | 0.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze 2-[(3-methyl-[1,2]thiazolo[4,5-d]pyrimidin-7-yl)amino]acetic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[(3-methyl-[1,2]thiazolo[4,5-d]pyrimidin-7-yl)amino]acetic acid?
The IUPAC name of 2-[(3-methyl-[1,2]thiazolo[4,5-d]pyrimidin-7-yl)amino]acetic acid (CID 83839373) is 2-[(3-methyl-[1,2]thiazolo[4,5-d]pyrimidin-7-yl)amino]acetic acid.
What is the SMILES notation for 2-[(3-methyl-[1,2]thiazolo[4,5-d]pyrimidin-7-yl)amino]acetic acid?
The canonical SMILES for 2-[(3-methyl-[1,2]thiazolo[4,5-d]pyrimidin-7-yl)amino]acetic acid is Cc1nsc2c(NCC(=O)O)ncnc12.
What is the InChIKey of 2-[(3-methyl-[1,2]thiazolo[4,5-d]pyrimidin-7-yl)amino]acetic acid?
The InChIKey is LNGYBTNALUSVHH-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H8N4O2S/c1-4-6-7(15-12-4)8(11-3-10-6)9-2-5(13)14/h3H,2H2,1H3,(H,13,14)(H,9,10,11).
What are the key properties of 2-[(3-methyl-[1,2]thiazolo[4,5-d]pyrimidin-7-yl)amino]acetic acid?
2-[(3-methyl-[1,2]thiazolo[4,5-d]pyrimidin-7-yl)amino]acetic acid has a molecular weight of 224.25 g/mol, XLogP of 0.89, 3 rotatable bonds, 2 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[(3-methyl-[1,2]thiazolo[4,5-d]pyrimidin-7-yl)amino]acetic acid is sourced from PubChem (CID 83839373), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).