About 7-bromoimidazo[1,5-a]pyridine-1-carbaldehyde
7-bromoimidazo[1,5-a]pyridine-1-carbaldehyde (PubChem CID 83839570) has the molecular formula C8H5BrN2O
and a molecular weight of 225.05 g/mol. Its IUPAC name is 7-bromoimidazo[1,5-a]pyridine-1-carbaldehyde.
Molecular Properties
| Compound Name | 7-bromoimidazo[1,5-a]pyridine-1-carbaldehyde |
| PubChem CID | 83839570 |
| Molecular Formula | C8H5BrN2O |
| Molecular Weight | 225.05 g/mol |
| Exact Mass | 223.96 |
| IUPAC Name | 7-bromoimidazo[1,5-a]pyridine-1-carbaldehyde |
| SMILES | O=Cc1ncn2ccc(Br)cc12 |
| InChI | InChI=1S/C8H5BrN2O/c9-6-1-2-11-5-10-7(4-12)8(11)3-6/h1-5H |
| InChIKey | XSWCQGIQZQGOIA-UHFFFAOYSA-N |
| XLogP | 1.91 |
| TPSA | 34.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 225.05 |
| LogP ≤ 5 | 1.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|
Analyze 7-bromoimidazo[1,5-a]pyridine-1-carbaldehyde with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 7-bromoimidazo[1,5-a]pyridine-1-carbaldehyde?
The IUPAC name of 7-bromoimidazo[1,5-a]pyridine-1-carbaldehyde (CID 83839570) is 7-bromoimidazo[1,5-a]pyridine-1-carbaldehyde.
What is the SMILES notation for 7-bromoimidazo[1,5-a]pyridine-1-carbaldehyde?
The canonical SMILES for 7-bromoimidazo[1,5-a]pyridine-1-carbaldehyde is O=Cc1ncn2ccc(Br)cc12.
What is the InChIKey of 7-bromoimidazo[1,5-a]pyridine-1-carbaldehyde?
The InChIKey is XSWCQGIQZQGOIA-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H5BrN2O/c9-6-1-2-11-5-10-7(4-12)8(11)3-6/h1-5H.
What are the key properties of 7-bromoimidazo[1,5-a]pyridine-1-carbaldehyde?
7-bromoimidazo[1,5-a]pyridine-1-carbaldehyde has a molecular weight of 225.05 g/mol, XLogP of 1.91, 1 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 7-bromoimidazo[1,5-a]pyridine-1-carbaldehyde is sourced from PubChem (CID 83839570), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).