2-[(6-chloro-1,3-benzoxazol-2-yl)amino]acetic acid

C9H7ClN2O3 — CID 83839879

IUPAC2-[(6-chloro-1,3-benzoxazol-2-yl)amino]acetic acid
SMILESO=C(O)CNc1nc2ccc(Cl)cc2o1
InChIInChI=1S/C9H7ClN2O3/c10-5-1-2-6-7(3-5)15-9(12-6)11-4-8(13)14/h1-3H,4H2,(H,11,12)(H,13,14)
InChIKeyBKRRXFIHHWAXCR-UHFFFAOYSA-N
MW226.62 g/mol
LogP1.98
Rot. Bonds3

About 2-[(6-chloro-1,3-benzoxazol-2-yl)amino]acetic acid

2-[(6-chloro-1,3-benzoxazol-2-yl)amino]acetic acid (PubChem CID 83839879) has the molecular formula C9H7ClN2O3 and a molecular weight of 226.62 g/mol. Its IUPAC name is 2-[(6-chloro-1,3-benzoxazol-2-yl)amino]acetic acid.

Molecular Properties

Compound Name2-[(6-chloro-1,3-benzoxazol-2-yl)amino]acetic acid
PubChem CID83839879
Molecular FormulaC9H7ClN2O3
Molecular Weight226.62 g/mol
Exact Mass226.01
IUPAC Name2-[(6-chloro-1,3-benzoxazol-2-yl)amino]acetic acid
SMILESO=C(O)CNc1nc2ccc(Cl)cc2o1
InChIInChI=1S/C9H7ClN2O3/c10-5-1-2-6-7(3-5)15-9(12-6)11-4-8(13)14/h1-3H,4H2,(H,11,12)(H,13,14)
InChIKeyBKRRXFIHHWAXCR-UHFFFAOYSA-N
XLogP1.98
TPSA75.36 Ų
H-Bond Donors2
H-Bond Acceptors4
Rotatable Bonds3
Heavy Atoms15
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500226.62
LogP ≤ 51.98
H-Bond Donors ≤ 52
H-Bond Acceptors ≤ 104

Analyze 2-[(6-chloro-1,3-benzoxazol-2-yl)amino]acetic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 2-[(6-chloro-1,3-benzoxazol-2-yl)amino]acetic acid?
The IUPAC name of 2-[(6-chloro-1,3-benzoxazol-2-yl)amino]acetic acid (CID 83839879) is 2-[(6-chloro-1,3-benzoxazol-2-yl)amino]acetic acid.
What is the SMILES notation for 2-[(6-chloro-1,3-benzoxazol-2-yl)amino]acetic acid?
The canonical SMILES for 2-[(6-chloro-1,3-benzoxazol-2-yl)amino]acetic acid is O=C(O)CNc1nc2ccc(Cl)cc2o1.
What is the InChIKey of 2-[(6-chloro-1,3-benzoxazol-2-yl)amino]acetic acid?
The InChIKey is BKRRXFIHHWAXCR-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H7ClN2O3/c10-5-1-2-6-7(3-5)15-9(12-6)11-4-8(13)14/h1-3H,4H2,(H,11,12)(H,13,14).
What are the key properties of 2-[(6-chloro-1,3-benzoxazol-2-yl)amino]acetic acid?
2-[(6-chloro-1,3-benzoxazol-2-yl)amino]acetic acid has a molecular weight of 226.62 g/mol, XLogP of 1.98, 3 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[(6-chloro-1,3-benzoxazol-2-yl)amino]acetic acid is sourced from PubChem (CID 83839879), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).