C13H18N4 — CID 83840471
1-(1-methylpyrrolo[3,2-b]pyridin-7-yl)piperidin-3-amine (PubChem CID 83840471) has the molecular formula C13H18N4 and a molecular weight of 230.31 g/mol. Its IUPAC name is 1-(1-methylpyrrolo[3,2-b]pyridin-7-yl)piperidin-3-amine.
| Compound Name | 1-(1-methylpyrrolo[3,2-b]pyridin-7-yl)piperidin-3-amine |
|---|---|
| PubChem CID | 83840471 |
| Molecular Formula | C13H18N4 |
| Molecular Weight | 230.31 g/mol |
| Exact Mass | 230.15 |
| IUPAC Name | 1-(1-methylpyrrolo[3,2-b]pyridin-7-yl)piperidin-3-amine |
| SMILES | Cn1ccc2nccc(N3CCCC(N)C3)c21 |
| InChI | InChI=1S/C13H18N4/c1-16-8-5-11-13(16)12(4-6-15-11)17-7-2-3-10(14)9-17/h4-6,8,10H,2-3,7,9,14H2,1H3 |
| InChIKey | MDZJCDIURZAAFN-UHFFFAOYSA-N |
| XLogP | 1.50 |
| TPSA | 47.08 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 230.31 |
| LogP ≤ 5 | 1.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |