About 3-[methyl(5,6,7,8-tetrahydroquinolin-2-yl)amino]propanoic acid
3-[methyl(5,6,7,8-tetrahydroquinolin-2-yl)amino]propanoic acid (PubChem CID 83841565) has the molecular formula C13H18N2O2
and a molecular weight of 234.30 g/mol. Its IUPAC name is 3-[methyl(5,6,7,8-tetrahydroquinolin-2-yl)amino]propanoic acid.
Analyze 3-[methyl(5,6,7,8-tetrahydroquinolin-2-yl)amino]propanoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-[methyl(5,6,7,8-tetrahydroquinolin-2-yl)amino]propanoic acid?
The IUPAC name of 3-[methyl(5,6,7,8-tetrahydroquinolin-2-yl)amino]propanoic acid (CID 83841565) is 3-[methyl(5,6,7,8-tetrahydroquinolin-2-yl)amino]propanoic acid.
What is the SMILES notation for 3-[methyl(5,6,7,8-tetrahydroquinolin-2-yl)amino]propanoic acid?
The canonical SMILES for 3-[methyl(5,6,7,8-tetrahydroquinolin-2-yl)amino]propanoic acid is CN(CCC(=O)O)c1ccc2c(n1)CCCC2.
What is the InChIKey of 3-[methyl(5,6,7,8-tetrahydroquinolin-2-yl)amino]propanoic acid?
The InChIKey is UOSOUMSVXVOBFS-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H18N2O2/c1-15(9-8-13(16)17)12-7-6-10-4-2-3-5-11(10)14-12/h6-7H,2-5,8-9H2,1H3,(H,16,17).
What are the key properties of 3-[methyl(5,6,7,8-tetrahydroquinolin-2-yl)amino]propanoic acid?
3-[methyl(5,6,7,8-tetrahydroquinolin-2-yl)amino]propanoic acid has a molecular weight of 234.30 g/mol, XLogP of 1.87, 4 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[methyl(5,6,7,8-tetrahydroquinolin-2-yl)amino]propanoic acid is sourced from PubChem (CID 83841565), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).