C15H26N8O — CID 838417
(2S)-2-[[4,6-bis(propan-2-ylamino)-1,3,5-triazin-2-yl]-cyanoamino]-N,N-dimethylpropanamide (PubChem CID 838417) has the molecular formula C15H26N8O and a molecular weight of 334.43 g/mol. Its IUPAC name is (2S)-2-[[4,6-bis(propan-2-ylamino)-1,3,5-triazin-2-yl]-cyanoamino]-N,N-dimethylpropanamide.
| Compound Name | (2S)-2-[[4,6-bis(propan-2-ylamino)-1,3,5-triazin-2-yl]-cyanoamino]-N,N-dimethylpropanamide |
|---|---|
| PubChem CID | 838417 |
| Molecular Formula | C15H26N8O |
| Molecular Weight | 334.43 g/mol |
| Exact Mass | 334.22 |
| IUPAC Name | (2S)-2-[[4,6-bis(propan-2-ylamino)-1,3,5-triazin-2-yl]-cyanoamino]-N,N-dimethylpropanamide |
| SMILES | CC(C)Nc1nc(NC(C)C)nc(N(C#N)[C@@H](C)C(=O)N(C)C)n1 |
| InChI | InChI=1S/C15H26N8O/c1-9(2)17-13-19-14(18-10(3)4)21-15(20-13)23(8-16)11(5)12(24)22(6)7/h9-11H,1-7H3,(H2,17,18,19,20,21)/t11-/m0/s1 |
| InChIKey | JKVLJNLOJVJRFM-NSHDSACASA-N |
| XLogP | 1.28 |
| TPSA | 110.07 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.43 |
| LogP ≤ 5 | 1.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'cyanate_/aminonitrile_/thiocyanate', 'substructure': 'N/A'}, {'alert_name': 'enamine', 'substructure': 'N/A'} |
|---|