C13H15ClN2 — CID 83841728
7-chloro-8-methyl-2,3,4,9-tetrahydro-1H-carbazol-3-amine (PubChem CID 83841728) has the molecular formula C13H15ClN2 and a molecular weight of 234.73 g/mol. Its IUPAC name is 7-chloro-8-methyl-2,3,4,9-tetrahydro-1H-carbazol-3-amine.
| Compound Name | 7-chloro-8-methyl-2,3,4,9-tetrahydro-1H-carbazol-3-amine |
|---|---|
| PubChem CID | 83841728 |
| Molecular Formula | C13H15ClN2 |
| Molecular Weight | 234.73 g/mol |
| Exact Mass | 234.09 |
| IUPAC Name | 7-chloro-8-methyl-2,3,4,9-tetrahydro-1H-carbazol-3-amine |
| SMILES | Cc1c(Cl)ccc2c3c([nH]c12)CCC(N)C3 |
| InChI | InChI=1S/C13H15ClN2/c1-7-11(14)4-3-9-10-6-8(15)2-5-12(10)16-13(7)9/h3-4,8,16H,2,5-6,15H2,1H3 |
| InChIKey | ZIVUZPHTHXMUAX-UHFFFAOYSA-N |
| XLogP | 2.95 |
| TPSA | 41.81 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 234.73 |
| LogP ≤ 5 | 2.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|